Estradiol benzoate cyclooctenyl ether

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| drug_name = EBCO

| IUPAC_name = [(8R,9S,13S,14S,17S)-17-[(1E)-cycloocten-1-yl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate

| image = Estradiol benzoate cyclooctenyl ether.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Estrogen; Estrogen ester; Estrogen ether

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 28200-94-4

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 6436089

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 4940765

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = EBCO; Estradiol 3-benzoate 17β-cyclooctenyl ether

| C=33 | H=40 | O=3

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O/C/4=C/CCCCCC4)CCC5=C3C=CC(=C5)OC(=O)C6=CC=CC=C6

| StdInChI_Ref =

| StdInChI = 1S/C33H40O3/c1-33-21-20-28-27-17-15-26(36-32(34)23-10-6-5-7-11-23)22-24(27)14-16-29(28)30(33)18-19-31(33)35-25-12-8-3-2-4-9-13-25/h5-7,10-12,15,17,22,28-31H,2-4,8-9,13-14,16,18-21H2,1H3/b25-12+/t28-,29-,30+,31+,33+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = DOFNLZKUGHVIMH-UQWKGHMASA-N

}}

Estradiol benzoate cyclooctenyl ether (EBCO), or estradiol 3-benzoate 17β-cyclooctenyl ether, is a synthetic estrogen as well as estrogen ester and ether – specifically, the C3 benzoate ester and C17β cyclooctenyl ether of estradiol – which was described in the early 1970s and was never marketed.{{cite journal | vauthors = Falconi G, Galletti F, Celasco G, Gardi R | title = Oral long-lasting estrogenic activity of estradiol 3-benzoate 17-cyclooctenyl ether | journal = Steroids | volume = 20 | issue = 5 | pages = 627–38 | date = November 1972 | pmid = 4654978 | doi = 10.1016/0039-128X(72)90020-7 }}{{cite journal | vauthors = Galletti F, Gardi R | title = Effect of two orally active estradiol derivatives on sulfobromphthalein retention in rats | journal = Pharmacol Res Commun | volume = 6 | issue = 2 | pages = 135–45 | date = April 1974 | pmid = 4438394 | doi = 10.1016/s0031-6989(74)80021-4 }}{{cite book|last1=Wermuth|first1=Camille G.|title=The Practice of Medicinal Chemistry|chapter=Designing Prodrugs and Bioprecursors|year=2008|pages=721–746|doi=10.1016/B978-0-12-374194-3.00036-6|isbn=9780123741943}}{{cite book|last1=Stella|first1=V.|title=Pro-drugs as Novel Drug Delivery Systems|chapter=Pro-drugs: An Overview and Definition|series=ACS Symposium Series|volume=14|year=1975|pages=1–115|issn=1947-5918|doi=10.1021/bk-1975-0014.ch001|isbn=0-8412-0291-5|doi-access=free}} It has been found to have a dramatically prolonged duration of action with oral administration in animals, similarly to the related compound quinestrol (the 3-cyclopentyl ether of ethinylestradiol).{{cite journal | vauthors = Epstein JA | title = Prolonged menstrual response of patients with gonadal failure following quinestrol administration | journal = Int. J. Fertil. | volume = 12 | issue = 2 | pages = 181–6 | date = 1967 | pmid = 6033895 }}{{cite journal | vauthors = Giannina T, Meli A | title = Prolonged oestrogenic activity in rats after single oral administration of ethinyloestradiol-3-cyclopentyl ether | journal = J. Pharm. Pharmacol. | volume = 21 | issue = 4 | pages = 271–2 | date = April 1969 | pmid = 4390151 | doi = 10.1111/j.2042-7158.1969.tb08247.x | s2cid = 19407816 }} A single oral dose of EBCO sustained high uterus weights for 3 weeks in rats. This long-lasting activity may be due to storage of EBCO in fat. It appears that EBCO is absorbed satisfactorily from the gastrointestinal tract, at least partially survives first-pass metabolism in the liver and intestines, and is then sequestered into fat, from which it is slowly released and activated into estradiol. In contrast to quinestrol, the oral activity of EBCO is greatly improved when it is delivered in an oil solution as opposed to an aqueous vehicle.

See also

References

{{Reflist}}

{{Estradiol}}

{{Estrogen receptor modulators}}

Category:Abandoned drugs

Category:Benzoate esters

Category:Estradiol esters

Category:Estrogen ethers

Category:Synthetic estrogens

{{Steroid-stub}}

{{Genito-urinary-drug-stub}}