Estradiol diacetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate

| image = estradiol diacetate.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 3434-88-6

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 66431

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 59804

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = X43EU3CQ8P

| KEGG =

| ChEBI =

| ChEMBL = 3138724

| synonyms = EDA; Estradiol 3,17β-diacetate; NSC-106559

| C=22 | H=28 | O=4

| SMILES = CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)OC(=O)C)C

| StdInChI_Ref =

| StdInChI = 1S/C22H28O4/c1-13(23)25-16-5-7-17-15(12-16)4-6-19-18(17)10-11-22(3)20(19)8-9-21(22)26-14(2)24/h5,7,12,18-21H,4,6,8-11H2,1-3H3/t18-,19-,20+,21+,22+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = VQHQLBARMFAKSV-AANPDWTMSA-N

}}

Estradiol diacetate (EDA), or estradiol 3,17β-diacetate, is an estrogen and an estrogen ester—specifically, the C3 and C17β diacetate ester of estradiol—which was never marketed.{{cite journal | vauthors = Junkmann K, Witzel H | title = Chemie und Pharmakologie von Steroidhormon-Estern | trans-title = Chemistry and pharmacology of steroid hormone esters | language = de | journal = Z Vitam Horm Fermentforsch | volume = 9 | issue = 1–2 | pages = 97–143 contd | date = 1957 | pmid = 13531579 }}{{cite journal | vauthors = Janocko L, Larner JM, Hochberg RB | title = The interaction of C-17 esters of estradiol with the estrogen receptor | journal = Endocrinology | volume = 114 | issue = 4 | pages = 1180–6 | date = April 1984 | pmid = 6705734 | doi = 10.1210/endo-114-4-1180 }}{{cite journal | vauthors = Mu Y, Peng S, Zhang A, Wang L | title = Role of pocket flexibility in the modulation of estrogen receptor alpha by key residue arginine 394 | journal = Environ. Toxicol. Chem. | volume = 30 | issue = 2 | pages = 330–6 | date = February 2011 | pmid = 21038436 | doi = 10.1002/etc.389 | bibcode = 2011EnvTC..30..330M | s2cid = 22116062 }}{{cite book | editor = Friedrich W. Derz | date = 1976 | title = ChemPRODUCTindex, Volumes 1-2 | publisher = De Gruyter | pages = 881– | isbn = 978-3-11-002141-7 | oclc = 2619908 | url = https://books.google.com/books?id=KaAgAAAAMAAJ&pg=PA881}} It is related to the estradiol monoesters estradiol acetate (estradiol 3-acetate; Femtrace) and estradiol 17β-acetate.

{{Affinities and estrogenic potencies of estrogen esters and ethers at the estrogen receptors}}