Estrofurate
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(9S,13S,14S,17S)-17-(furan-3-yl)-17-hydroxy-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate
| image = Estrofurate.svg
| width =
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 10322-73-3
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| PubChem = 66360
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 59738
| UNII = 0CDE7T54KW
| ChEMBL = 2104224
| KEGG = D04069
| C=24 | H=26 | O=4
| smiles = CC(=O)OC1=CC2=C(C=C1)C3CCC4(C(C3=CC2)CCC4(C5=COC=C5)O)C
| StdInChI_Ref =
| StdInChI = 1S/C24H26O4/c1-15(25)28-18-4-6-19-16(13-18)3-5-21-20(19)7-10-23(2)22(21)8-11-24(23,26)17-9-12-27-14-17/h4-6,9,12-14,20,22,26H,3,7-8,10-11H2,1-2H3/t20-,22+,23+,24-/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = AEVUURWLDCELOV-AYVPJYCDSA-N
| synonyms =
}}
Estrofurate (INN, USAN; development code AY-11483), also known as 17α-(3-furyl)-estra-1,3,5(10),7-tetraene-3,17-diol 3-acetate, is a synthetic, steroidal estrogen that was synthesized in 1967 and studied in the late 1960s and early 1970s but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA472|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=503}}{{cite journal | vauthors = Banik UK, Revesz C, Herr F | title = Orally active oestrogens and progestins in prevention of pregnancy in rats | journal = Journal of Reproduction and Fertility | volume = 18 | issue = 3 | pages = 509–15 | date = April 1969 | pmid = 4182486 | doi = 10.1530/jrf.0.0180509 | doi-access = free }} It is a relatively weak estrogen in bioassays.{{cite journal | vauthors = Revesz C, Banik UK, Lefebvre Y | title = AY-11483, a new type of orally active oestrogen | journal = Journal of Reproduction and Fertility | volume = 22 | issue = 1 | pages = 27–32 | date = June 1970 | pmid = 5421116 | doi = 10.1530/jrf.0.0220027 | doi-access = free }}
References
{{Reflist|2}}
{{Estrogenics}}
{{genito-urinary-drug-stub}}
{{steroid-stub}}