Estrone cyanate
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = 17-Oxoestra-1(10),2,4-trien-3-yl cyanate
| image = Estrone cyanate.svg
| width = 250px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = By mouth
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 23623-36-1
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem =
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 26377079
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YV53AV45DS
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = Estrocyanate; Estrone 3-O-cyanate; Estrone 3-cyanate
| C=19 | H=21 | N=1 | O=2
| smiles = C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1CCC2=O)OC#N
| StdInChI_Ref =
| StdInChI = 1S/C19H21NO2/c1-19-9-8-15-14-5-3-13(22-11-20)10-12(14)2-4-16(15)17(19)6-7-18(19)21/h3,5,10,15-17H,2,4,6-9H2,1H3/t15-,16-,17+,19+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = OIOQBNDENVAFEU-VXNCWWDNSA-N
}}
Estrone cyanate, or estrone 3-O-cyanate, also known as estrocyanate, is an estrogen and an estrogen ester – specifically, the 3-O-cyanate ester of estrone – which was investigated for potential use in birth control pills but was found to be of relatively low potency and ultimately was never marketed.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA900|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=900}}{{cite book|title=Endokrinologie|volume=59|publisher=Johann Ambrosius Barth Verlag|url=https://books.google.com/books?id=NZi3AAAAIAAJ|year=1972|page=293}}{{cite journal | vauthors = Göretzlehner G, Kühne D, Dässler CG | title = [Experimental studies with the new synthetic estrogen, estrocyanate] | language = de | journal = Dtsch Gesundheitsw | volume = 26 | issue = 34 | pages = 1614–7 | date = August 1971 | pmid = 5117100 }}{{cite journal | vauthors = Carol W, Klinger G, Hempel E, Böhm W, Chemnitius KH | title = [Experimental and clinical studies with new estrogen derivatives] | language = de | journal = Endokrinologie | volume = 59 | issue = 3 | pages = 282–94 | year = 1972 | pmid = 5071777 }}
References
{{Reflist}}
{{Estrogen receptor modulators}}
{{Steroid-stub}}
{{Genito-urinary-drug-stub}}