Estrone methyl ether

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,13S,14S)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one

| image = Estrone methyl ether.svg

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Estrogen; Estrogen ether

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1624-62-0

| CAS_supplemental =
1091-94-7

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 92895

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| UNII = 4SMZ4A51IJ

| KEGG =

| ChEBI =

| ChEMBL = 1409077

| synonyms = Oestrone methyl ether; Estrone 3-methyl ether; 3-Methoxyestrone; 3-Methoxyestra-1,3,5(10)-trien-17-one

| C=19 | H=24 | O=2

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OC

| StdInChI_Ref =

| StdInChI = 1S/C19H24O2/c1-19-10-9-15-14-6-4-13(21-2)11-12(14)3-5-16(15)17(19)7-8-18(19)20/h4,6,11,15-17H,3,5,7-10H2,1-2H3/t15-,16-,17+,19+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = BCWWDWHFBMPLFQ-VXNCWWDNSA-N

}}

Estrone methyl ether, or estrone 3-methyl ether, is a synthetic estrogen and estrogen ether – specifically, the C3 methyl ether of estrone – which was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA900|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=900–}}{{cite book| vauthors = Milne GW |title=Drugs: Synonyms and Properties: Synonyms and Properties|url=https://books.google.com/books?id=xUlaDwAAQBAJ&pg=PT1406|date=8 May 2018|publisher=Taylor & Francis|isbn=978-1-351-78989-9|pages=1406–}} It has been used to synthesize mestranol (ethinylestradiol 3-methyl ether).{{cite book| vauthors = Ravina E |title=The Evolution of Drug Discovery: From Traditional Medicines to Modern Drugs|url=https://books.google.com/books?id=iDNy0XxGqT8C&pg=PA190|date=11 January 2011|publisher=John Wiley & Sons|isbn=978-3-527-32669-3|pages=190–}}