Etamicastat

{{Short description|Abandoned cardiovascular drug}}

{{Infobox drug

| drug_name =

| image = Etamicastat.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Dopamine β-hydroxylase inhibitor

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 760173-05-5

| CAS_supplemental =

| PubChem = 10450387

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank = DB15288

| ChemSpiderID = 8625804

| UNII = 9X96V6DBU4

| KEGG =

| ChEBI =

| ChEMBL = 1196088

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = BIA 5-453; BIA-5-453

| IUPAC_name = 4-(2-aminoethyl)-3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-1H-imidazole-2-thione

| C=14 | H=15 | F=2 | N=3 | O=1 | S=1

| SMILES = C1[C@H](COC2=C1C=C(C=C2F)F)N3C(=CNC3=S)CCN

| StdInChI = 1S/C14H15F2N3OS/c15-9-3-8-4-11(7-20-13(8)12(16)5-9)19-10(1-2-17)6-18-14(19)21/h3,5-6,11H,1-2,4,7,17H2,(H,18,21)/t11-/m1/s1

| StdInChIKey = CWWWTTYMUOYSQA-LLVKDONJSA-N

}}

Etamicastat ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name BIA 5-453) is a peripherally selective dopamine β-hydroxylase (DBH) inhibitor which was under development for the treatment of hypertension (high blood pressure) and heart failure but was never marketed.{{cite web | title=Etamicastat | website=AdisInsight | date=27 December 2019 | url=https://adisinsight.springer.com/drugs/800034724 | access-date=21 October 2024}}{{cite journal | vauthors = Dey SK, Saini M, Prabhakar P, Kundu S | title = Dopamine β hydroxylase as a potential drug target to combat hypertension | journal = Expert Opin Investig Drugs | volume = 29 | issue = 9 | pages = 1043–1057 | date = September 2020 | pmid = 32658551 | doi = 10.1080/13543784.2020.1795830 | url = }} The peripheral selectivity of etamicastat is in contrast to the earlier DBH inhibitor nepicastat, which is centrally active and produced associated side effects. Etamicastat was found to reduce blood pressure but not affect heart rate in clinical trials. The development of etamicastat was discontinued by August 2016.