Ethylestradiol

{{Short description|Chemical compound}}

{{Distinguish|Ethinylestradiol|Ethylestrenol}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,13S,14S,17S)-17-Ethyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol

| image = 17-Ethylestradiol.svg

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Estrogen

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2553-34-6

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 66428

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = JL3XDL8DYL

| KEGG =

| ChEBI =

| ChEMBL = 1627625

| synonyms = 17α-Ethylestradiol; 17α-Ethylestra-1,3,5(10)-triene-3,17β-diol

| C=20 | H=28 | O=2

| SMILES = CC[C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)O)C)O

| StdInChI_Ref =

| StdInChI = 1S/C20H28O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h5,7,12,16-18,21-22H,3-4,6,8-11H2,1-2H3/t16-,17-,18+,19+,20+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = GQHYKMYMSVJXJM-SLHNCBLASA-N

}}

Ethylestradiol, or 17α-ethylestradiol, also known as 17α-ethylestra-1,3,5(10)-triene-3,17β-diol, is a synthetic estrogen which was never marketed. It occurs as an active metabolite of the anabolic steroids norethandrolone and ethylestrenol formed via aromatase and is believed to be responsible for the estrogenic effects of norethandrolone and ethylestrenol.{{cite book| first = William | last = Llewellyn | name-list-style = vanc |title=Anabolics|url=https://books.google.com/books?id=afKLA-6wW0oC&pg=PT330|year=2011|publisher=Molecular Nutrition Llc|isbn=978-0-9828280-1-4|pages=330–,591–598}} The 3-methyl ether of ethylestradiol has been used as an intermediate in the synthesis of certain 19-nortestosterone anabolic steroids.{{cite journal| vauthors = Colton FB, Nysted LN, Riegel B, Raymond AL |title=17-Alkyl-19-nortestosterones|journal=Journal of the American Chemical Society|volume=79|issue=5|year=1957|pages=1123–1127|issn=0002-7863|doi=10.1021/ja01562a028|bibcode=1957JAChS..79.1123C }}{{cite journal| vauthors = Fedorova OI, Pekarskaya ES, Lukashina IV, Grinenko GS |title=Synthesis of some derivatives op 19-nortestosterone from estra-1,3,5(10)-trienes|journal=Pharmaceutical Chemistry Journal|volume=8|issue=8|year=1974|pages=462–465|issn=0091-150X|doi=10.1007/BF00757882|s2cid=27243268}}{{cite book|author=William Andrew Publishing|title=Pharmaceutical Manufacturing Encyclopedia|url=https://books.google.com/books?id=_J2ti4EkYpkC&pg=PA1513|date=22 October 2013|publisher=Elsevier|isbn=978-0-8155-1856-3|pages=1513–}}