Etiocholane

{{Chembox

| ImageFile = Androstane_5beta.png

| ImageSize = 200px

| ImageAlt =

| IUPACName = 5β-Androstane

| SystematicName = (3aS,3bS,5aS,9aS,9bS,11aS)-9a,11a-Dimethylhexadecahydro-1H-cyclopenta[a]phenanthrene

| OtherNames = 5-Epiandrostane

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 438-23-3

| PubChem = 6857462

| ChemSpiderID = 5256799

| InChI = 1/C19H32/c1-18-11-5-7-16(18)15-9-8-14-6-3-4-12-19(14,2)17(15)10-13-18/h14-17H,3-13H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1

| InChIKey = QZLYKIGBANMMBK-DYKIIFRCBC

| StdInChI = 1S/C19H32/c1-18-11-5-7-16(18)15-9-8-14-6-3-4-12-19(14,2)17(15)10-13-18/h14-17H,3-13H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1

| StdInChIKey = QZLYKIGBANMMBK-DYKIIFRCSA-N

| SMILES = C[C@@]12CCC[C@H]1[C@@H]3CC[C@@H]4CCCC[C@@]4([C@H]3CC2)C

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 709K2QDA3I

}}

| Section2 = {{Chembox Properties

| C = 19 | H = 32

| MolarMass = 260.465 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Etiocholane, also known as 5β-androstane or 5-epiandrostane, is an androstane (C19) steroid. It is the 5β-isomer of androstane. Etiocholanes include 5β-androstanedione, 5β-dihydrotestosterone, 3α,5β-androstanediol, 3β,5β-androstanediol, etiocholanolone, epietiocholanolone, and 3α,5β-androstanol.

17β-Ethyletiocholanes, or 5β-pregnanes,{{cite book|author=William M. Haynes|title=CRC Handbook of Chemistry and Physics, 93rd Edition|url=https://books.google.com/books?id=c1rNBQAAQBAJ&pg=SA3-PA462|date=19 April 2016|publisher=CRC Press|isbn=978-1-4398-8050-0|pages=3–}} include 5β-dihydroprogesterone, pregnanolone, and epipregnanolone, as well as pregnanediol and pregnanetriol.