Evogliptin

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| IUPAC_name = (3R)-4-[(3R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-{[(2-methyl-2-propanyl)oxy]methyl}-2-piperazinone

| image = Evogliptin.svg

| alt =

| caption =

| pronounce =

| tradename = Suganon

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration = By mouth

| legal_AU =

| legal_AU_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 1222102-29-5

| class =

| ATCvet =

| ATC_prefix = A10

| ATC_suffix = BH07

| PubChem = 25022354

| DrugBank =

| ChemSpiderID = 26339341

| UNII = 09118300L7

| ChEMBL = 1779710

| KEGG = D11023

| synonyms = DA-1229

| C=19|H=26|F=3|N=3|O=3

| smiles = CC(C)(C)OC[C@@H]1C(=O)NCCN1C(=O)C[C@@H](Cc2cc(c(cc2F)F)F)N

| StdInChI=1S/C19H26F3N3O3/c1-19(2,3)28-10-16-18(27)24-4-5-25(16)17(26)8-12(23)6-11-7-14(21)15(22)9-13(11)20/h7,9,12,16H,4-6,8,10,23H2,1-3H3,(H,24,27)/t12-,16-/m1/s1

| StdInChIKey=LCDDAGSJHKEABN-MLGOLLRUSA-N

}}

Evogliptin (INN; trade names Suganon, Evodine) is an antidiabetic drug in the dipeptidyl peptidase-4 (DPP-4) inhibitor or "gliptin" class of drugs.{{cite journal | vauthors = McCormack PL | title = Evogliptin: First Global Approval | journal = Drugs | volume = 75 | issue = 17 | pages = 2045–9 | date = November 2015 | pmid = 26541763 | doi = 10.1007/s40265-015-0496-5 | s2cid = 46450821 }} It was developed by the South Korean pharmaceutical company Dong-A ST and is approved for use in South Korea{{Cite news | title = Dong-A ST's DPP4 inhibitor, SUGANON, got approved for type 2 diabetes in Korea | date = October 2, 2015 | url = https://www.pipelinereview.com/index.php/2015100259148/Small-Molecules/Dong-A-STs-DPP4-inhibitor-SUGANON-got-approved-for-type-2-diabetes-in-Korea.html | publisher = pipelinereview.com | access-date = February 1, 2017 | archive-date = June 30, 2022 | archive-url = https://web.archive.org/web/20220630134355/https://pipelinereview.com/index.php/2015100259148/Small-Molecules/Dong-A-STs-DPP4-inhibitor-SUGANON-got-approved-for-type-2-diabetes-in-Korea.html | url-status = dead }} and Russia.{{cite web |title=Evodine (evogliptin) film-coated tablets. Full prescribing information |url=http://grls.rosminzdrav.ru/Grls_View_v2.aspx?routingGuid=6c9be7e5-6693-4b07-9f31-0175437b053e&t= |website=Russian State Register of Medicines |language=Russian}} In a meta-analysis involving data from 6 randomized controlled trials (887 patients), Dutta et. al. demonstrated the good glycaemic efficacy and safety of this medicine as compared to other DPP4 inhibitors like sitagliptin and linagliptin. {{cite journal | vauthors = Dutta D, Bhattacharya S, Krishnamurthy A, Sharma LK, Sharma M | title = Efficacy and Safety of Novel Dipeptidyl-Peptidase-4 Inhibitor Evogliptin in the Management of Type 2 Diabetes Mellitus: A Meta-Analysis. | journal = Indian J Endocrinol Metab | volume = 24 | issue = 5 | date = Nov 2020 | pages = 434–445 | pmid = 33489850 | doi = 10.4103/ijem.IJEM_418_20 | pmc = 7810058 | doi-access = free }}

References

{{Reflist}}

{{Oral hypoglycemics and insulin analogs}}

Category:Dipeptidyl peptidase-4 inhibitors

Category:Fluoroarenes

Category:Piperazinones

Category:Tert-butyl compounds

{{gastrointestinal-drug-stub}}