F-11461
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| verifiedrevid =
| IUPAC_name = 2-[4-[4-[7-(Methoxy-11C)-1-naphthalenyl]-1-piperazinyl]butyl]-4-methyl-1,2,4-triazine-3,5(2H,4H)-dione
| image = F-11,461.svg
| width = 200
| tradename =
| legal_status =
| IUPHAR_ligand =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 874471-25-7
| ChEMBL = 199824
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = RKG24J8KJR
| PubChem = 10324985
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 9850903
| C=23| H=29 | N=5 | O=3
| smiles = O=C1C=NN(C(=O)N1C)CCCCN2CCN(C3=CC=CC4=CC=C(O[11C])C=C43)CC2
| StdInChI_Ref =
| StdInChI = InChI=1S/C23H29N5O3/c1-25-22(29)17-24-28(23(25)30)11-4-3-10-26-12-14-27(15-13-26)21-7-5-6-18-8-9-19(31-2)16-20(18)21/h5-9,16-17H,3-4,10-15H2,1-2H3/i2-1
| StdInChIKey_Ref =
| StdInChIKey = GKTQBPYMIGXPKG-JVVVGQRLSA-N
}}
F-11,461 is a naphthylpiperazine drug that acts as an agonist of the 5-HT1A receptor (Ki = 1.36 nM) that has been used as a radioligand in PET studies. It possesses modest affinity for the 5-HT7 (Ki = 9.1 nM) and D4 (Ki = 8.5 nM) receptors, although the interaction of F-11,461 with these receptors is not detectable with PET due to their relative scarcity in the brain.{{cite journal | vauthors = Kumar JS, Majo VJ, Hsiung SC, Millak MS, Liu KP, Tamir H, Prabhakaran J, Simpson NR, Van Heertum RL, Mann JJ, Parsey RV | display-authors = 6 | title = Synthesis and in vivo validation of [O-methyl-11C]2-{4-[4-(7-methoxynaphthalen-1-yl)piperazin- 1-yl]butyl}-4-methyl-2H-[1,2,4]triazine-3,5-dione: a novel 5-HT1A receptor agonist positron emission tomography ligand | journal = Journal of Medicinal Chemistry | volume = 49 | issue = 1 | pages = 125–134 | date = January 2006 | pmid = 16392798 | doi = 10.1021/jm050725j }}