FC-75

{{chembox

| verifiedrevid = 424980388

|ImageFile=FC-75.png

|ImageSize=

|IUPACName= 2,2,3,3,4,4,5-heptafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)tetrahydrofuran

|OtherNames=Perfluorocyclic ether, Fluorinert FC-75,
Perfluoro-compound FC-75,
Perfluoro-2-n-butyl THF,
Perfluoro(butyltetrahydrofuran)

|Section1= {{Chembox Identifiers

| Abbreviations=PFBTHF

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=335-36-4

| Beilstein = 341263

| ChEBI = 39023

| ChemSpiderID = 71309

| EINECS=206-389-5

| PubChem=78976

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = MSL8VN7XHA

| StdInChI=1S/C8F16O/c9-1(10,4(15,16)7(20,21)22)2(11,12)6(19)3(13,14)5(17,18)8(23,24)25-6

| StdInChIKey = FYJQJMIEZVMYSD-UHFFFAOYSA-N

| SMILES=C1(C(C(OC1(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)F)(F)F)(F)F)(F)F

}}

|Section2= {{Chembox Properties

| Formula=C₈F₁₆O

| MolarMass=416.06

| Appearance=

| Density=

| MeltingPtC=-88

| BoilingPtC=102

| Solubility=Insoluble

}}

|Section3= {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt=

}}

}}

FC-75 is a fluorocarbon derivative of tetrahydrofuran with the chemical formula C₈F₁₆O. It is practically insoluble in water.

It is one of the 3M Fluorinert fluids. It is used as an inert coolant fluid in electronics and other applications, and as a solvent. FC-75 can be synthesized by the same electrochemical fluorination process used to produce PFOA.{{cite encyclopedia

|last=Savu |first=P

|encyclopedia=Kirk-Othmer Encyclopedia of Chemical Terminology

|title=Fluorinated Higher Carboxylic Acids

|year=1994

|publisher=John Wiley & Sons, Inc

|doi=10.1002/0471238961.0612211519012221.a01|isbn=9780471484943

}} However, other perfluorinated ether isomers will also result.

:H(CH₂)₇COCl + HF → H(CH₂)₇COF + C₇H₁₆ + 2C₈F₁₆O + HCl + H₂

A similar fluorocarbon-based coolant and solvent is perfluorohexane.