FERb 033

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 2-Chloro-3′-fluoro-3,4′-dihydroxy-[1,1-biphenyl]-4-carboxaldehyde oxime

| image = FERb 033.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1111084-78-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9FUT9FH3EX

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem =

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 24606020

| KEGG =

| ChEBI =

| ChEMBL =

| C=13 | H=9 | Cl=1 | F=1 | N=1 | O=3

| smiles = c1cc(c(cc1c2ccc(c(c2Cl)O)/C=N/O)F)O

| StdInChI_Ref =

| StdInChI = 1S/C13H9ClFNO3/c14-12-9(3-1-8(6-16-19)13(12)18)7-2-4-11(17)10(15)5-7/h1-6,17-19H/b16-6+

| StdInChIKey_Ref =

| StdInChIKey = LRRMQNGSYOUANY-OMCISZLKSA-N

| synonyms =

}}

FERb 033 is a synthetic, nonsteroidal estrogen that was synthesized in 2009 and is used in scientific research.{{cite journal | vauthors = Minutolo F, Bertini S, Granchi C, Marchitiello T, Prota G, Rapposelli S, Tuccinardi T, Martinelli A, Gunther JR, Carlson KE, Katzenellenbogen JA, Macchia M | title = Structural evolutions of salicylaldoximes as selective agonists for estrogen receptor beta | journal = J. Med. Chem. | volume = 52 | issue = 3 | pages = 858–67 | year = 2009 | pmid = 19128016 | doi = 10.1021/jm801458t }}{{cite journal | vauthors = Reese JM, Suman VJ, Subramaniam M, Wu X, Negron V, Gingery A, Pitel KS, Shah SS, Cunliffe HE, McCullough AE, Pockaj BA, Couch FJ, Olson JE, Reynolds C, Lingle WL, Spelsberg TC, Goetz MP, Ingle JN, Hawse JR | title = ERβ1: characterization, prognosis, and evaluation of treatment strategies in ERα-positive and -negative breast cancer | journal = BMC Cancer | volume = 14 | pages = 749 | year = 2014 | pmid = 25288324 | pmc = 4196114 | doi = 10.1186/1471-2407-14-749 | doi-access = free }} It is a potent and selective ERβ agonist (K_i = 7.1 nM, EC₅₀ = 4.8 nM), with 62-fold selectivity for the ERβ over the ERα.