FG-5893

{{Short description|Substance for treatment of alcoholism}}

{{Technical|date=June 2025}}

{{Infobox drug

| drug_name = FG-5893

| image = FG-5893.svg

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 150527-23-4

| CAS_supplemental =

| PubChem = 127728

| IUPHAR_ligand = 13

| DrugBank =

| ChemSpiderID = 113304

| UNII = 2QR7EI62WQ

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = FG5893

| IUPAC_name = methyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate

| C=27 | H=29 | F=2 | N=3 | O=3

| SMILES = COC(=O)C1=C(N=CC=C1)N2CCN(CC2)CCCC(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F

| StdInChI = 1S/C27H29F2N3O2/c1-34-27(33)25-4-2-14-30-26(25)32-18-16-31(17-19-32)15-3-5-24(20-6-10-22(28)11-7-20)21-8-12-23(29)13-9-21/h2,4,6-14,24H,3,5,15-19H2,1H3

| StdInChIKey = NDCPNKXUTJGQQC-UHFFFAOYSA-N

}}

FG-5893 is a chemical from the diphenylbutylpiperazine class of agents. It is a 5-HT1A agonist and a 5-HT2A antagonist.{{cite journal | vauthors = Myers RD | title = New drugs for the treatment of experimental alcoholism | journal = Alcohol | location = Fayetteville, N.Y. | volume = 11 | issue = 6 | pages = 439–451 | date = 1994 | pmid = 7865140 | doi = 10.1016/0741-8329(94)90064-7 | department = review }}

It is believed to be an anxiolytic agent with potential uses in the treatment of substance abuse disorders particularly alcoholism.{{cite journal | vauthors = Albinsson A, Björk A, Svartengren J, Klint T, Andersson G | title = Preclinical pharmacology of FG5893: a potential anxiolytic drug with high affinity for both 5-HT1A and 5-HT2A receptors | journal = European Journal of Pharmacology | volume = 261 | issue = 3 | pages = 285–94 | date = August 1994 | pmid = 7813550 | doi = 10.1016/0014-2999(94)90119-8 | url = }}{{cite journal | vauthors = Lankford MF, Björk AK, Myers RD | title = Differential efficacy of serotonergic drugs FG5974, FG5893, and amperozide in reducing alcohol drinking in P rats | journal = Alcohol (Fayetteville, N.Y.) | volume = 13 | issue = 4 | pages = 399–404 | date = 1996 | pmid = 8836330 | doi = 10.1016/0741-8329(96)00061-4 | url = }}{{cite journal | vauthors = Long TA, Kalmus GW, Björk A, Myers RD | title = Alcohol intake in high alcohol drinking (HAD) rats is suppressed by FG5865, a novel 5-HT1A agonist/5-HT2 antagonist | journal = Pharmacology, Biochemistry, and Behavior | volume = 53 | issue = 1 | pages = 33–40 | date = January 1996 | pmid = 8848457 | doi = 10.1016/0091-3057(95)00195-6 | url = }}

There is evidence for FG-5893 behaving as a SNDRI:{{cite journal | vauthors=((Pettersson, E.)) | journal=European Journal of Pharmacology | title=Studies of four novel diphenylbutylpiperazinepyridyl derivatives on release and inhibition of reuptake of dopamine, serotonin and noradrenaline by rat brain in vitro | volume=282 | issue=1–3 | pages=131–135 | date= August 1995 | doi=10.1016/0014-2999(95)00300-A}}

CNS review:{{cite journal | vauthors=((Andersson, G.)), ((Albinsson, A.)), ((Björk, A.)), ((Svartengren, J.)) | journal=CNS Drug Reviews | title=FG5893: A Potential New Generation Anxiolytic/Antidepressant Drug with High Affinity for 5‐HT 1A and 5‐HT 2A Receptors | volume=2 | issue=4 | pages=363–383 | date= December 1996 | doi=10.1111/j.1527-3458.1996.tb00307.x}}