Fananserin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 449580698

| IUPAC_name = 2-(3-(4-(p-Fluorophenyl)-1-piperazinyl)propyl)-2H-naphth(1,8-cd)isothiazole 1,1-dioxide

| image = Fananserin.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 5434

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 127625-29-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 60785

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 54781

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 38QJ762ET6

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02656

| C=23 | H=24 | F=1 | N=3 | O=2 | S=1

| smiles = C1CN(CCN1CCCN2C3=CC=CC4=C3C(=CC=C4)S2(=O)=O)C5=CC=C(C=C5)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C23H24FN3O2S/c24-19-8-10-20(11-9-19)26-16-14-25(15-17-26)12-3-13-27-21-6-1-4-18-5-2-7-22(23(18)21)30(27,28)29/h1-2,4-11H,3,12-17H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VGIGHGMPMUCLIQ-UHFFFAOYSA-N

| synonyms = Fananserin

}}

Fananserin (RP-62203) is a drug which acts as a potent antagonist at both the 5HT_2A receptor,{{cite journal | vauthors = Malleron JL, Comte MT, Gueremy C, Peyronel JF, Truchon A, Blanchard JC, Doble A, Piot O, Zundel JL, Huon C | display-authors = 6 | title = Naphthosultam derivatives: a new class of potent and selective 5-HT2 antagonists | journal = Journal of Medicinal Chemistry | volume = 34 | issue = 8 | pages = 2477–83 | date = August 1991 | pmid = 1908521 | doi = 10.1021/jm00112a025 }} and the Dopamine D₄ receptor,{{cite journal | vauthors = Heuillet E, Petitet F, Mignani S, Malleron JL, Lavayre J, Néliat G, Doble A, Blanchard JC | display-authors = 6 | title = The naphtosultam derivative RP 62203 (fananserin) has high affinity for the dopamine D4 receptor | journal = European Journal of Pharmacology | volume = 314 | issue = 1–2 | pages = 229–33 | date = October 1996 | pmid = 8957240 | doi = 10.1016/s0014-2999(96)00554-7 }} but without blocking other dopamine receptors such as D₂.{{cite journal | vauthors = Doble A, Girdlestone D, Piot O, Allam D, Betschart J, Boireau A, Dupuy A, Guérémy C, Ménager J, Zundel JL | display-authors = 6 | title = Pharmacological characterization of RP 62203, a novel 5-hydroxytryptamine 5-HT2 receptor antagonist | journal = British Journal of Pharmacology | volume = 105 | issue = 1 | pages = 27–36 | date = January 1992 | pmid = 1596688 | doi = 10.1111/j.1476-5381.1992.tb14206.x | pmc = 1908636 }} It has sedative{{cite journal | vauthors = Stutzmann JM, Eon B, Lucas M, Blanchard JC, Laduron PM | title = RP 62203, a 5-hydroxytryptamine2 antagonist, enhances deep NREM sleep in rats | journal = Sleep | volume = 15 | issue = 2 | pages = 119–24 | date = April 1992 | pmid = 1579785 | doi = 10.1093/sleep/15.2.119 | doi-access = free }} and antipsychotic effects, and has been researched for the treatment of schizophrenia,{{cite journal | vauthors = Sramek JJ, Kirkesseli S, Paccaly-Moulin A, Davidson J, Jhee SS, Hourani J, Sémiond D, Cutler NR | display-authors = 6 | title = A bridging study of fananserin in schizophrenic patients | journal = Psychopharmacology Bulletin | year = 1998 | volume = 34 | issue = 4 | pages = 811–8 | pmid = 10513457 }} although efficacy was less than expected and results were disappointing.{{cite journal | vauthors = Truffinet P, Tamminga CA, Fabre LF, Meltzer HY, Rivière ME, Papillon-Downey C | title = Placebo-controlled study of the D₄/5-HT_2A antagonist fananserin in the treatment of schizophrenia | journal = The American Journal of Psychiatry | volume = 156 | issue = 3 | pages = 419–25 | date = March 1999 | pmid = 10080558 | doi = 10.1176/ajp.156.3.419 | s2cid = 41422352 |url = https://ajp.psychiatryonline.org/doi/10.1176/ajp.156.3.419}}