Farampator

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 406196055

| IUPAC_name = 2,1,3-benzoxadiazol-6-yl-piperidin-1-ylmethanone

| image = Farampator.svg

| width = 222

| image2 = Farampator ball-and-stick model.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Investigational New Drug

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 211735-76-1

| ATC_prefix =

| ATC_suffix =

| PubChem = 4118151

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3331565

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 7X6P5N8K2L

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04131

| C=12 | H=13 | N=3 | O=2

| smiles = C1CCN(CC1)C(=O)C2=CC3=NON=C3C=C2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H13N3O2/c16-12(15-6-2-1-3-7-15)9-4-5-10-11(8-9)14-17-13-10/h4-5,8H,1-3,6-7H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XFVRBYKKGGDPAJ-UHFFFAOYSA-N

| synonyms = CX-691; ORG-24448

}}

Farampator (developmental code names CX-691, ORG-24448, SCH-900460) is an ampakine drug. It was developed by Cortex Pharmaceuticals, and licensed to Organon BioSciences for commercial development. Following the purchase of Organon by Schering-Plough in 2007, the development license to farampator was transferred. The development of farampator was eventually terminated, reportedly due to concerns about cardiac toxicity.{{Cite web|url=http://adisinsight.springer.com/drugs/800012259|title = Farampator - AdisInsight}}{{cite journal | vauthors = Froestl W, Muhs A, Pfeifer A | title = Cognitive enhancers (nootropics). Part 1: drugs interacting with receptors | journal = J. Alzheimers Dis. | volume = 32 | issue = 4 | pages = 793–887 | year = 2012 | pmid = 22886028 | doi = 10.3233/JAD-2012-121186 }}

Farampator has been investigated for its effect on AMPA receptors and researched for potential use in the treatment of schizophrenia and Alzheimer's disease. It was found to improve short-term memory, but impaired episodic memory. It produced side effects such as headache, somnolence and nausea. Subjects reporting side effects had significantly higher plasma levels of farampator than subjects without.{{citation needed|date=August 2017}} Additional analyses revealed that in the farampator condition the group without side effects showed a significantly superior memory performance relative to the group with side effects.{{cite journal | vauthors = Wezenberg E, Verkes RJ, Ruigt GS, Hulstijn W, Sabbe BG | date = Jun 2007 | title = Acute effects of the ampakine farampator on memory and information processing in healthy elderly volunteers | journal = Neuropsychopharmacology | volume = 32 | issue = 6| pages = 1272–83 | doi = 10.1038/sj.npp.1301257 | pmid = 17119538 | doi-access = free }}