Fast Yellow AB

{{More citations needed|date=December 2009}}

{{Chembox

| verifiedrevid = 431847509

| ImageFile = Fast yellow AB.svg

| ImageSize = 240

| ImageAlt = Skeletal formula of Fast Yellow AB

| ImageFile1 = Fast Yellow AB 3D ball.png

| ImageSize1 = 240

| ImageAlt1 = Ball-and-stick model of the Fast Yellow AB molecule

| IUPACName = 2-amino-5-[(E)-(4-sulfophenyl)diazenyl]benzenesulfonic acid

| OtherNames = {{Unbulleted list|Fast Yellow|Acid Yellow|Food Yellow 2|C.I. 13015}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 101-50-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2ZQE5CCH2H

| EC_number = 202-947-7

| ChEBI = 86124

| ChEMBL = 2172377

| PubChem = 60996

| PubChem1 = 75918

| PubChem1_Comment = Na salt

| ChemSpiderID = 54957

| StdInChI=1S/C12H11N3O6S2/c13-11-6-3-9(7-12(11)23(19,20)21)15-14-8-1-4-10(5-2-8)22(16,17)18/h1-7H,13H2,(H,16,17,18)(H,19,20,21)

| StdInChIKey = DCYBHNIOTZBCFS-UHFFFAOYSA-N

| SMILES = Nc1ccc(cc1OS(O)=O)/N=N/c2ccc(OS(O)=O)cc2

}}

|Section2={{Chembox Properties

| C=12|H=11|N=3|O=6|S=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

}}

Fast Yellow AB is an azo dye. It used to be used as a food dye, designated in Europe by the E number E105. It is now delisted in both Europe and USA and is forbidden if used in foods and drinks, as toxicological data has shown it is harmful. E105 has been implicated in non-atopic asthma.[http://datasheets.scbt.com/sc-214221.pdf STATEMENT OF HAZARDOUS NATURE. Synonyms: ...Fast Yellow AB...] pdf