Febarbamate

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444539972

| IUPAC_name = [1-butoxy-3-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-
diazinan-1-yl)propan-2-yl] carbamate

| image = Febarbamate.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 13246-02-1

| ATC_prefix = M03

| ATC_suffix = BA05

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104283

| PubChem = 25803

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24039

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5Z48ONN38P

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07275

| synonyms = MS-543

| C = 20 | H = 27 | N = 3 | O = 6

| smiles = C1(=O)NC(C(C(=O)N1CC(OC(=O)N)COCCCC)(C2=CC=CC=C2)CC)=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H27N3O6/c1-3-5-11-28-13-15(29-18(21)26)12-23-17(25)20(4-2,16(24)22-19(23)27)14-9-7-6-8-10-14/h6-10,15H,3-5,11-13H2,1-2H3,(H2,21,26)(H,22,24,27)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QHZQILHUJDRDAI-UHFFFAOYSA-N

}}

Febarbamate (INN; Solium, Tymium), also known as phenobamate, is an anxiolytic and tranquilizer of the barbiturate and carbamate families which is used in Europe by itself and as part of a combination drug formulation called tetrabamate.{{cite web | url = http://whqlibdoc.who.int/hq/2004/WHO_EDM_QSM_2004.5.pdf | author = World Health Organization | title = The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substance | year = 2004 }}{{cite book | title = Index nominum 2000: international drug directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA333 | access-date = 26 November 2011 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 427}}{{cite journal | author = Gentili E | title = [Therapeutic effects of a new psycholeptic agent (febarbamate, Solium) in pediatrics] | language = it | journal = Minerva Medica | volume = 63 | issue = 18 | pages = 1058–60 |date=March 1972 | pmid = 5016064 }}{{cite book | vauthors = Morton I, Hall JM| title = Concise dictionary of pharmacological agents: properties and synonyms | url = https://books.google.com/books?id=mqaOMOtk61IC&pg=PA118 | access-date = 26 November 2011 | year = 1999 | publisher = Springer | isbn = 978-0-7514-0499-9 | pages = 118}}