Felcisetrag

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = methyl 4-[[4-[[(2-propan-2-yl-1H-benzimidazole-4-carbonyl)amino]methyl]piperidin-1-yl]methyl]piperidine-1-carboxylate

| image = Felcisetrag.svg

| width = 240

| tradename =

| legal_status =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 916075-84-8

| PubChem = 11961293

| ChemSpiderID = 10135539

| UNII = 35F0Y2W16Q

| ChEMBL = 2402904

| DrugBank = DB12725

| KEGG = D12157

| IUPHAR_ligand = 8426

| C=25 | H=37 | N=5 | O=3

| smiles = CC(C)C1=NC2=C(C=CC=C2N1)C(=O)NCC3CCN(CC3)CC4CCN(CC4)C(=O)OC

| StdInChI = 1S/C25H37N5O3/c1-17(2)23-27-21-6-4-5-20(22(21)28-23)24(31)26-15-18-7-11-29(12-8-18)16-19-9-13-30(14-10-19)25(32)33-3/h4-6,17-19H,7-16H2,1-3H3,(H,26,31)(H,27,28)

| StdInChIKey = MZOITCJKGUIQEI-UHFFFAOYSA-N

}}

Felcisetrag (TAK-954, TD-8954) is a drug which acts as a potent and highly selective agonist for the serotonin receptor 5-HT₄. It is in clinical trials for the treatment of gastroparesis.{{cite journal | vauthors = Chedid V, Brandler J, Arndt K, Vijayvargiya P, Wang XJ, Burton D, Harmsen WS, Siegelman J, Chen C, Chen Y, Almansa C, Dukes G, Camilleri M | title = Randomised study: effects of the 5-HT₄ receptor agonist felcisetrag vs placebo on gut transit in patients with gastroparesis | journal = Alimentary Pharmacology & Therapeutics | volume = 53 | issue = 9 | pages = 1010–1020 | date = May 2021 | pmid = 33711180 | pmc = 8251541 | doi = 10.1111/apt.16304 }}{{cite journal | vauthors = Pusalkar S, Chowdhury SK, Czerniak R, Zhu X, Li Y, Balani SK, Ramsden D | title = Clinical and Nonclinical Disposition and In Vitro Drug-Drug Interaction Potential of Felcisetrag, a Highly Selective and Potent 5-HT₄ Receptor Agonist | journal = European Journal of Drug Metabolism and Pharmacokinetics | volume = 47 | issue = 3 | pages = 371–386 | date = May 2022 | pmid = 35157234 | pmc = 9050781 | doi = 10.1007/s13318-021-00751-8 }}{{cite journal | vauthors = Patel P, Zaher EA, Khataniar H, Ebrahim MA, Loganathan P | title = Safety and Efficacy of Highly Selective 5-Hydroxytryptamine Receptor 4 Agonists for Diabetic and Idiopathic Gastroparesis: A Systematic Review and Meta-Analysis of Randomized Controlled Trials | journal = Cureus | volume = 16 | issue = 1 | pages = e51851 | date = January 2024 | pmid = 38327939 | pmc = 10848606 | doi = 10.7759/cureus.51851 | doi-access = free }}{{cite journal | vauthors = Boeckxstaens G, Ayad S, Dukes G, Essandoh M, Gryder R, Kamble P, Tackett J, Thakker P, Williams J, Zhang Y, Wade PR | title = A randomized phase 2 study of the 5-HT₄ receptor agonist felcisetrag for postoperative gastrointestinal dysfunction after bowel surgery | journal = American Journal of Surgery | volume = 234 | pages = 162–171 | date = August 2024 | pmid = 38724293 | doi = 10.1016/j.amjsurg.2024.04.030 | doi-access = free }}