Fenbufen

{{Short description|Nonsteroidal anti-inflammatory drug, now withdrawn}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443753907

| IUPAC_name = 4-(4-Biphenylyl)-4-oxobutanoic acid
or
4-Oxo-4-(4-phenylphenyl)butanoic acid

| image = Fenbufen.svg

| image_class = skin-invert-image

| image2 = Fenbufen-from-xtal-1988-3D-balls.png

| tradename =

| Drugs.com = {{drugs.com|international|fenbufen}}

| pregnancy_category =

| legal_UK = POM

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 36330-85-5

| ATC_prefix = M01

| ATC_suffix = AE05

| ATC_supplemental =

| PubChem = 3335

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08981

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3218

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9815R1WR9B

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01344

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 31599

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 277522

| C=16 | H=14 | O=3

| smiles = O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZPAKPRAICRBAOD-UHFFFAOYSA-N

| melting_point = 186

}}

Fenbufen is a nonsteroidal anti-inflammatory drug used to treat pain.{{cite journal | vauthors = Moore RA, Derry S, McQuay HJ | title = Single dose oral fenbufen for acute postoperative pain in adults | journal = The Cochrane Database of Systematic Reviews | volume = 2009 | issue = 4 | pages = CD007547 | date = October 2009 | pmid = 19821427 | pmc = 4175557 | doi = 10.1002/14651858.CD007547.pub2 }}

Fenbufen is a member of the propionic acid derivatives class of drugs.{{cite journal | vauthors = Brogden RN | title = Non-steroidal anti-inflammatory analgesics other than salicylates | journal = Drugs | volume = 32 | pages = 27–45 | date = 1986 | issue = Suppl 4 | pmid = 3552584 | doi = 10.2165/00003495-198600324-00004 | s2cid = 25471102 }}

It was introduced by American Cyanamid under the trade name Lederfen in the 1980s. Due to liver toxicity, it was withdrawn from markets in the developed world in 2010.{{cite web | work = Monthly Index of Medical Specialities (MIMS) | publisher = Haymarket Media Group Ltd. | url = http://www.mims.co.uk/deleted-products-2010/article/978347 | title = Deleted products 2010 }}{{cite book | vauthors = Lewis JH, Stine JG | chapter = Nonsteroidal Antiinflammatory Drugs and Leukotriene Receptor Antagonists. Chapter 22 | title = Drug-Induced Liver Disease | edition = 3rd | veditors = Kaplowitz N, DeLeve LD | publisher = Academic Press | date = 2013 | isbn = 978-0-12-387818-2 }}{{rp|370, 383-384}}

As of 2015 it was available in Taiwan and Thailand under several brand names.{{cite web | work = Drugs.com | url = https://www.drugs.com/international/fenbufen.html | title = International listings for fenbufen | access-date = 25 June 2015 }}

Preparation

Fenbufen can be synthesized by acylation of biphenyl with succinic anhydride under Friedel-Crafts conditions.{{cite journal | vauthors = Castillo R, Suárez-Herrera M, Aparicio M, Hernández-Lui F, Hernández A | title = An Improved Synthesis of Fenbulen | journal = Organic Preparations and Procedures International | date = October 1995 | volume = 27 | issue = 5 | pages = 550–552 | doi = 10.1080/00304949509458497 }}

References

{{Reflist}}

{{Anti-inflammatory and antirheumatic products}}

{{Prostanoidergics}}

{{Use dmy dates|date=December 2020}}

Category:Hepatotoxins

Category:Nonsteroidal anti-inflammatory drugs

Category:Withdrawn drugs

{{musculoskeletal-drug-stub}}