Fenoxazoline
{{Short description|Chemical compound}}
{{One source|date=September 2014}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 447929930
| IUPAC_name = 2-[(2-propan-2-ylphenoxy)methyl]-4,5-dihydro-1H-imidazole
| image = Fenoxazoline.svg
| width = 175
| tradename = Aturgyl, Nasofelin, Nebulicina
| Drugs.com = {{drugs.com|international|fenoxazoline}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status = Rx-only (BR)
| routes_of_administration = Topical (nasal solution)
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 4846-91-7
| ATC_prefix = R01
| ATC_suffix = AA12
| PubChem = 71899
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 14012
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 64911
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 97JJW1W1R3
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07372
| C=13 | H=18 | N=2 | O=1
| SMILES = CC(C)C1=CC=CC=C1OCC2=NCCN2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C13H18N2O/c1-10(2)11-5-3-4-6-12(11)16-9-13-14-7-8-15-13/h3-6,10H,7-9H2,1-2H3,(H,14,15)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GFYSWQDCHLWRMQ-UHFFFAOYSA-N
}}
Fenoxazoline (trade name Aturgyl in Brazil) is a nasal decongestant.{{cite journal | vauthors = Lorino AM, Lofaso F, Dahan E, Coste A, Harf A, Lorino H | title = Combined effects of a mechanical nasal dilator and a topical decongestant on nasal airflow resistance | journal = Chest | volume = 115 | issue = 6 | pages = 1514–8 | date = June 1999 | pmid = 10378542 | doi = 10.1378/chest.115.6.1514 }}
Fenmetozole has the precise same formula, albeit instead of an ortho-isopropyl group, 3',4'-dich was chosen instead.
References
{{Reflist}}
External links
- {{Commonscatinline|Fenoxazoline}}
{{Nasal preparations}}
{{Adrenergic receptor modulators}}
Category:Alpha-adrenergic agonists
{{respiratory-system-drug-stub}}