Fenoxycarb

{{chembox

| verifiedrevid = 443757269

| Name = Fenoxycarb

| ImageFile = Fenoxycarb v2.svg

| ImageSize = 260

| ImageAlt = Skeletal formula of fenoxycarb

| ImageFile1 = Fenoxycarb-3D-spacefill.png

| ImageSize1 = 240

| ImageAlt1 = Space-filling model of the fenoxycarb molecule

| PIN = Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate

| OtherNames = Varikill, Insegar, Logic

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 46739

| PubChem = 51605

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C11078

| InChI = 1/C17H19NO4/c1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,18,19)

| InChIKey = HJUFTIJOISQSKQ-UHFFFAOYAM"

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 15780

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H19NO4/c1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,18,19)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HJUFTIJOISQSKQ-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 72490-01-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = JEN0LSV1G9

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 5009

| SMILES = O=C(OCC)NCCOc2ccc(Oc1ccccc1)cc2

}}

| Section2 = {{Chembox Properties

| Formula = C17H19NO4

| MolarMass = 301.34 g/mol

| MeltingPtC = 53.5

}}

}}

Fenoxycarb is an insect growth regulator.[http://pmep.cce.cornell.edu/profiles/extoxnet/dienochlor-glyphosate/fenoxycarb-ext.html Cornell University site on Fenoxycarb]{{Cite book |last1=Pener |first1=Meir Paul |title=Insect Growth Disruptors |last2=Dhadialla |first2=Tarlochan S. |date=2012 |publisher=Academic Press |isbn=978-0-12-391500-9 |series=Advances in Insect Physiology |volume=43 |location=Oxford |pages=1–162 |chapter=An Overview of Insect Growth Disruptors; Applied Aspects |doi=10.1016/B978-0-12-391500-9.00001-2 |issn=0065-2806 |chapter-url=https://doi.org/10.1016%2FB978-0-12-391500-9.00001-2}}{{Cite book |last1=Jeschke |first1=Peter |url=https://doi.org/10.1002/9783527699261.ch29 |title=Modern Crop Protection Compounds |last2=Witschel |first2=Matthias |last3=Krämer |first3=Wolfgang |last4=Schirmer |first4=Ulrich |publisher=Wiley |year=2019 |isbn=9783527699261 |pages=1013–1065 |chapter=Chapter 29. Insect Molting and Metamorphosis |doi=10.1002/9783527699261.ch29}} It has a low toxicity for bees, birds, and humans, but is toxic to fish. The oral LD50 for rats is greater than {{convert|16,800|mg/kg}}.U.S. Environmental Protection Agency (1983-85). Chemical Information Fact Sheet. Office of Pesticides and Toxic Substances, Office of Pesticide Programs (TS-766C)

Fenoxycarb is non-neurotoxic and does not have the same mode of action as other carbamate insecticides. Instead, it prevents immature insects from reaching maturity by mimicking juvenile hormone (IRAC group 7B).[http://www.cdpr.ca.gov/docs/emon/pubs/fatememo/fenxycrb.pdf John Sullivan, Dept. of Pesticide Regulation, Sacramento CA 2000]{{cite journal | last1=Dhadialla | first1=Tarlochan S. | last2=Carlson | first2=Glenn R. | last3=Le | first3=Dat P. | title=New insecticides with ecdysteroidal and juvenile hormone activity | journal=Annual Review of Entomology | publisher=Annual Reviews | volume=43 | issue=1 | year=1998 | issn=0066-4170 | doi=10.1146/annurev.ento.43.1.545 | pages=545–569 | pmid=9444757}}

References