Fenpiprane

{{short description|Chemical compound}}

{{MCN|date=April 2025}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443773826

| IUPAC_name = 1-[3,3-di(phenyl)propyl]piperidine

| image = Fenpiprane.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 3540-95-2

| ATC_prefix = A03

| ATC_suffix = AX01

| PubChem = 197785

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S2FVB1RL5X

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07091

| ChEMBL = 49943

| ChemSpiderID = 171191

| C=20 | H=25 | N=1

| smiles = C1CCN(CC1)CCC(C2=CC=CC=C2)C3=CC=CC=C3

| StdInChI = 1S/C20H25N/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21/h1-2,4-7,10-13,20H,3,8-9,14-17H2

}}

Fenpiprane is a drug used for the management of functional gastrointestinal disorders.{{cite journal | vauthors = Whitfield KL, Shulman RJ | title = Treatment options for functional gastrointestinal disorders: from empiric to complementary approaches | journal = Pediatric Annals | volume = 38 | issue = 5 | pages = 288-90, 292-4 | date = May 2009 | pmid = 19476303 | pmc = 2830707 }}{{cite journal | vauthors = Black CJ, Drossman DA, Talley NJ, Ruddy J, Ford AC | title = Functional gastrointestinal disorders: advances in understanding and management | journal = Lancet | volume = 396 | issue = 10263 | pages = 1664–1674 | date = November 2020 | pmid = 33049221 | doi = 10.1016/S0140-6736(20)32115-2 | s2cid = 222253972 | url = https://eprints.whiterose.ac.uk/166984/3/THELANCET-D-20-00966R3%20CLEAN.pdf }}{{cite journal | vauthors = Olden KW | title = The use of antidepressants in functional gastrointestinal disorders: new uses for old drugs | journal = CNS Spectrums | volume = 10 | issue = 11 | pages = 891–896 | date = November 2005 | pmid = 16273017 | doi = 10.1017/s1092852900019866 | s2cid = 416219 }}