Fentin acetate

{{chembox

| Verifiedfields = changed

| verifiedrevid = 461100007

|Reference=[https://www.sigmaaldrich.com/US/en/product/sial/45491 Fentin acetate] at Sigma-Aldrich

|ImageFile=Ph3SnOAc.svg

|ImageSize=130px

|ImageAlt = Skeletal formula of fentin acetate

|ImageFile1=

|ImageSize1=185

|ImageAlt1 =

|IUPACName= (acetoxy)(triphenyl)stannane

|OtherNames=Phentin acetate; Triphenyltin acetate; Triphenylstannyl acetate; Acetic acid tri(phenyl)stannyl ester, Brestan

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=900-95-8

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 76-87-9

| CASNo2_Comment = (fentin hydroxide)

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 81918

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 474376

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8085060

| EINECS = 212-984-0

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18728

| PubChem=16682804

| UNII = 70M92GQA9T

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII2 = KKL46V5313

| UNII2_Comment = (fentin hydroxide)

| UNII2_Ref = {{fdacite|correct|FDA}}

| InChI = 1/3C6H5.C2H4O2.Sn/c3*1-2-4-6-5-3-1;1-2(3)4;/h3*1-5H;1H3,(H,3,4);/q;;;;+1/p-1/rC18H15Sn.C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2(3)4/h1-15H;1H3,(H,3,4)/q+1;/p-1

| InChIKey = WDQNIWFZKXZFAY-FRUPRYIZAN

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/3C6H5.C2H4O2.Sn/c3*1-2-4-6-5-3-1;1-2(3)4;/h3*1-5H;1H3,(H,3,4);/q;;;;+1/p-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WDQNIWFZKXZFAY-UHFFFAOYSA-M

| SMILES = [O-]C(=O)C.c3c([Sn+](c1ccccc1)c2ccccc2)cccc3

}}

|Section2={{Chembox Properties

| C=20|H=18|O=2|Sn=1

| MolarMass=409.07 g/mol

| Appearance=

| Density=

| MeltingPtC= 122–124

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=Very toxic
Dangerous for the environment

| FlashPt=

| AutoignitionPt=

| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|301|311|315|318|330|335|351|372|361d|410}}

| PPhrases = {{P-phrases|201|202|260|264|270|271|273|280|284|301+310|302+352|304+340|305+351+338|308+313|310|320|330|332+313|361|363|391|403+233|405|501}}

| LD50 = 21 mg/kg (guinea pig, oral)
30 mg/kg (rabbit, oral)
81 mg/kg (mouse, oral)
125 mg/kg (rat, oral){{IDLH|tin-org|Tin (organic compounds, as Sn)}}

}}

}}

Fentin acetate is an organotin compound with the formula (C₆H₅)₃SnO₂CCH₃. It is a colourless solid that was previously used as a fungicide.G. G. Graf "Tin, Tin Alloys, and Tin Compounds" in Ullmann's Encyclopedia of Industrial Chemistry, 2005, Wiley-VCH.{{doi|10.1002/14356007.a27_049}}[https://pubchem.ncbi.nlm.nih.gov/compound/Fentin-acetate Fentin Acetate]. PubChem. National Library of Medicine. NIH. Accessed 13 July 2023.