Ferrous tartrate
{{Chembox
| Name = Ferrous tartrate
| ImageFile = Ferrous tartrate.svg
| ImageSize = 150px
| ImageAlt =
| IUPACName = (2R,3R)-2,3-dihydroxybutanedioate; iron(2+)
| OtherNames = Iron wine, Ferrous tartrate, Vinum Ferri
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 2944-65-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZRW631PTZD
| PubChem = 6451676
| SMILES = C(C(C(=O)[O-])O)(C(=O)[O-])O.[Fe+2]
| ChemSpiderID = 4954134
| InChI = 1S/C4H6O6.Fe/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2/t1-,2-;/m1./s1
}}
|Section2={{Chembox Properties
| Formula = C4H4FeO6
| MolarMass = 203.92 g/mol
| Appearance = Reddish powder
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
| VaporPressure =
}}
|Section7={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = B03
| ATCCode_suffix = AA08
| AdminRoutes = Oral
| Bioavail = yes
| Excretion =
| HalfLife =
| Metabolism =
| Legal_status =
| Legal_US = OTC
| Legal_US_comment =
| Legal_UK = GSL
| Legal_AU =
| Legal_CA = OTC
| Pregnancy_category = N (US)
| Pregnancy_AU =
| Pregnancy_AU_comment =
| ProteinBound =
}}
}}
Ferrous tartrate is a chemical compound and the iron(II) salt of tartaric acid.{{cite web|url=http://www.chemspider.com/Chemical-Structure.7970014.html|title=Ferrous tartrate|work=chemspider.com|accessdate=20 June 2015}}
Historical uses
Ferrous tartrate has been used as a steel medicine.{{cite book|title=Pharmacopoeia of the City of London Hospital for Diseases of the Chest, Victoria Park|date=1908|location=London|page=50|url=https://archive.org/details/pharmacopoeiaofc00londuoft?ui=embed#page/50/mode/1up|language=la}}{{cite book|author=J. A. Forret|title=The Pharmaceutical Journal and Transactions|chapter-url=https://books.google.com/books?id=010CAAAAYAAJ&pg=PA640|year=1891|publisher=J. & A. Churchill|pages=640–641|chapter=Notes on Iron Wine}} It was generally prescribed during the 19th and early 20th centuries. It is usually prepared by digesting for 30 days, {{convert|2|oz|gr|abbr=off}} tartarated iron{{cite book|author=Harry Napier Draper|title=Manual of the medicinal preparations of Iron, including their preparation, chemistry, physiological action, and therapeutical use. With an appendix, containing the Iron Preparations of the British Pharmacopœia|url=https://books.google.com/books?id=NWFZAAAAcAAJ&pg=PA118|year=1864|page=118}} in a pint of sherry.{{cite book|last=Ruoff|first=Henry W.|title=The Century Book of Facts|url=https://archive.org/details/centurybookoffac00ruofiala|date=1901|publisher=King-Richardson Company|page=[https://archive.org/details/centurybookoffac00ruofiala/page/405 405]}} It can be difficult to prepare.{{cite book|title=The Analytical Review, Or History of Literature, Domestic and Foreign, on an Enlarged Plan|url=https://books.google.com/books?id=bE4oAAAAYAAJ&pg=PA195|volume=2|year=1788|page=195}}
Historically, it was used as a stomachic and tonic, at a dose of 2 tbsp. It was also used to treat anemia, dose 1 to 2 fl. dr.{{cite book|last=Brunton|first=T. Lauder|title=A Text-Book Of Pharmacology, Therapeutics And Materia Medica|url=http://chestofbooks.com/health/materia-medica-drugs/Pharmacology-Therapeutics-Drugs/B-P-Vinum-Ferri.html|chapter=B.P. Vinum Ferri|year=1885|publisher=Macmillan And Co|edition=3rd}}
References
{{Reflist}}
{{Antianemic preparations}}
Category:Drugs acting on the gastrointestinal system and metabolism