Fesoterodine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 461100276

| image = Fesoterodine.svg

| width = 250

| alt =

| image2 = Fesoterodine 3D spacefill.png

| width2 = 220

| alt2 = Space-filling model of the fesoterodine molecule

| caption =

| pronounce =

| tradename = Fesobig , Toviaz

| Drugs.com = {{drugs.com|monograph|fesoterodine-fumarate}}

| MedlinePlus = a609021

| DailyMedID = Fesoterodine

| routes_of_administration = By mouth

| class =

| ATC_prefix = G04

| ATC_suffix = BD11

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = Rx-only

| legal_CA_comment = {{cite web | title=Product monograph brand safety updates | website=Health Canada | date=6 June 2024 | url=https://www.canada.ca/en/health-canada/services/drugs-health-products/drug-products/drug-product-database/label-safety-assessment-update/product-monograph-brand-safety-updates.html | access-date=8 June 2024}}

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment =

| legal_EU = Rx-only

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability = 52% (active metabolite)

| protein_bound = 50% (active metabolite)

| metabolism = Liver (CYP2D6- and 3A4-mediated)

| elimination_half-life = 7–8 hours (active metabolite)

| excretion = Kidney (70%) and fecal (7%)

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 286930-02-7

| CAS_supplemental =

| PubChem = 6918558

| IUPHAR_ligand = 7473

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB06702

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5293755

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 621G617227

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07226

| ChEBI_Ref =

| ChEBI =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201764

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = [2-[(1R)-3-(Di(propan-2-yl)amino)-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate

| C=26 | H=37 | N=1 | O=3

| SMILES = O=C(Oc1ccc(cc1[C@@H](c2ccccc2)CCN(C(C)C)C(C)C)CO)C(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C26H37NO3/c1-18(2)26(29)30-25-13-12-21(17-28)16-24(25)23(22-10-8-7-9-11-22)14-15-27(19(3)4)20(5)6/h7-13,16,18-20,23,28H,14-15,17H2,1-6H3/t23-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DCCSDBARQIPTGU-HSZRJFAPSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Fesoterodine (INN, used as the fumarate under the brand name Toviaz) is an antimuscarinic drug developed by Schwarz Pharma AG to treat overactive bladder syndrome (OAB).{{cite web| url=http://www.medicalnewstoday.com/articles/41688.php| title=Fesoterodine, New Drug Candidate For Treatment For Overactive Bladder – Pfizer To Acquire Exclusive Worldwide Rights| date=17 April 2006| publisher=Medical News Today| access-date=2 November 2007| archive-date=16 May 2011| archive-url=https://web.archive.org/web/20110516020517/http://www.medicalnewstoday.com/articles/41688.php| url-status=dead}} It was approved by the European Medicines Agency in April 2007,{{cite web |url= http://www.emea.europa.eu/humandocs/Humans/EPAR/toviaz/toviaz.htm |title=Toviaz: European Public Assessment Report, Revision 3 - Published 02/06/08 |date=2 June 2008 |publisher=European Medicines Agency |url-status=dead |archive-url=https://web.archive.org/web/20080401005811/http://www.emea.europa.eu/humandocs/Humans/EPAR/toviaz/toviaz.htm |archive-date=2008-04-01 }} the US Food and Drug Administration on October 31, 2008 {{cite press release

| title = Pfizer's Toviaz (fesoterodine fumarate) Receives FDA Approval for the Treatment of Overactive Bladder

| publisher = Pfizer Inc.

| date = 2008-10-31

| url = https://www.drugs.com/newdrugs/pfizer-s-toviaz-fesoterodine-fumarate-receives-fda-approval-overactive-bladder-1167.html

| access-date = 2008-11-06

| archive-date = 2018-09-20

| archive-url = https://web.archive.org/web/20180920075736/https://www.drugs.com/newdrugs/pfizer-s-toviaz-fesoterodine-fumarate-receives-fda-approval-overactive-bladder-1167.html

| url-status = live

}} and Health Canada on February 9, 2012.{{Cite web |url=http://www.hc-sc.gc.ca/dhp-mps/prodpharma/sbd-smd/drug-med/nd_ad_2012_toviaz_142326-eng.php |title=Notice of Decision for TOVIAZ |access-date=2012-04-20 |archive-url=https://web.archive.org/web/20120423124138/http://www.hc-sc.gc.ca/dhp-mps/prodpharma/sbd-smd/drug-med/nd_ad_2012_toviaz_142326-eng.php |archive-date=2012-04-23 |url-status=dead }}

Fesoterodine is a prodrug. It is broken down into its active metabolite, desfesoterodine, by plasma esterases.