Flavone

{{Chembox

| ImageFile = Flavon num.svg

| ImageSize = 220px

| ImageClass = skin-invert

| IUPACName = 2-phenylchromen-4-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 525-82-6

| CASNo_Ref = {{Cascite|correct|CAS}}

| Beilstein = 157598

| ChEBI = 42491

| ChEMBL = 275638

| ChemSpiderID = 10230

| DrugBank = DB07776

| EC_number = 208-383-8

| Gmelin = 1224858

| IUPHAR_ligand = 409

| KEGG = C15608

| PubChem = 10680

| RTECS = DJ3100630

| UNII = S2V45N7G3B

| StdInChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H

| StdInChIKey = VHBFFQKBGNRLFZ-UHFFFAOYSA-N

| SMILES = C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2

}}

|Section2={{Chembox Properties

| C = 15|O=2|H=10

| MolarMass =

| Appearance = white solid

| Density =

| MeltingPtC = 96-97

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Flavone is an organic compound with the formula {{chem2|C6H4OC3H(Ph)O}}. A white solid, flavone is a derivative of chromone with a phenyl (Ph) substituent adjacent to the ether group. The compound is of little direct practical importance, but substituted derivatives, the flavones and flavonoids are a large class of nutritionally important natural products.{{cite journal |doi=10.1021/cr400265z|title=Chromone: A Valid Scaffold in Medicinal Chemistry |year=2014 |last1=Gaspar |first1=Alexandra |last2=Matos |first2=Maria João |last3=Garrido |first3=Jorge |last4=Uriarte |first4=Eugenio |last5=Borges |first5=Fernanda |journal=Chemical Reviews |volume=114 |issue=9 |pages=4960–4992 |url=https://repositorio-aberto.up.pt/handle/10216/70808 }} Flavone can be prepared in the laboratory by cyclization of 2-hydroxacetophenone.{{cite journal |doi=10.15227/orgsyn.032.0072|title=Flavone |journal=Organic Syntheses |year=1952 |volume=32 |page=72|author=T. S. Wheeler }} Isomeric with flavone is isoflavone, where the phenyl group is adjacent to the ketone.