Flavoxanthin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 420197997

| Reference =Merck Index, 11th Edition, 4032.

| ImageFile =Flavoxanthin.png

| ImageSize =320px

| ImageAlt = Skeletal formula of flavoxanthin

| ImageFile1 = Flavoxanthin 3D spacefill.png

| ImageSize1 = 320

| ImageAlt1 = Space-filling model of the flavoxanthin molecule

| IUPACName = (3R,5R,8R,3′R,6′R)-5,8-Epoxy-5,8-dihydro-β,ε-carotene-3,3′-diol

| SystematicName = (2R,6S,7aR)-2-{(2E,4E,6E,8E,10E,12E,14E,16E)-17-[(1R,4R)-4-Hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-6,11,15-trimethylheptadeca-2,4,6,8,10,12,14,16-octaen-2-yl}-4,4,7a-trimethyl-2,4,5,6,7,7a-hexahydro-1-benzofuran-6-ol

| OtherNames ={{Unbulleted list

| 5,8-Epoxy-5,8-dihydro-γ-carotene-3,3'-diol

| all-trans-Flavoxanthin

| E161a

}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo =512-29-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S1D2WO17XX

| PubChem =5281238

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4444650

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 5087

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C08594

| SMILES = CC1=C[C@@H](CC([C@H]1\C=C\C(=C\C=C\C(=C\C=C\C=C(/C)\C=C\C=C(/C)\[C@H]2C=C3C(C[C@@H](C[C@]3(O2)C)O)(C)C)\C)\C)(C)C)O

| InChI = 1/C40H56O3/c1-28(17-13-18-30(3)21-22-35-32(5)23-33(41)25-38(35,6)7)15-11-12-16-29(2)19-14-20-31(4)36-24-37-39(8,9)26-34(42)27-40(37,10)43-36/h11-24,33-36,41-42H,25-27H2,1-10H3/b12-11+,17-13+,19-14+,22-21+,28-15+,29-16+,30-18+,31-20+/t33-,34-,35-,36+,40+/m0/s1

| InChIKey = JRHJXXLCNATYLS-NGZWBNMCBG

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C40H56O3/c1-28(17-13-18-30(3)21-22-35-32(5)23-33(41)25-38(35,6)7)15-11-12-16-29(2)19-14-20-31(4)36-24-37-39(8,9)26-34(42)27-40(37,10)43-36/h11-24,33-36,41-42H,25-27H2,1-10H3/b12-11+,17-13+,19-14+,22-21+,28-15+,29-16+,30-18+,31-20+/t33-,34-,35-,36+,40+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JRHJXXLCNATYLS-NGZWBNMCSA-N

}}

|Section2={{Chembox Properties

| Formula =C40H56O3

| MolarMass =584.87 g/mol

| Appearance =Yellow solid

| Density =

| MeltingPtC = 184

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Flavoxanthin is a natural xanthophyll pigment with a golden-yellow color found in small quantities in a variety of plants. As a food additive it used under the E number E161a as a food coloring although it is not approved for use in the EUUK Food Standards Agency: {{cite web |url=http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist |title=Current EU approved additives and their E Numbers |access-date=2011-10-27}} or USA.{{citation needed|date=October 2011}} It is listed as food additive 161a in Australia and New Zealand where it is approved for usage as an ingredient in food products.Australia New Zealand Food Standards Code{{cite web |url=http://www.comlaw.gov.au/Details/F2011C00827 |title=Standard 1.2.4 - Labelling of ingredients |access-date=2011-10-27}}

References