Flexuosol A
{{chembox
| verifiedrevid =
| Name = Flexuosol A
| ImageFile = Flexuosol A.svg
| ImageSize = 200px
| ImageName = Chemical structure of flexuosol A
| ImageAlt = Chemical structure of flexuosol A
| PIN = 5-[(2R,3R)-4-{(2S,3S,5R,6R)-5-(3,5-Dihydroxyphenyl)-2,6-bis(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethen-1-yl]-2,3,5,6-tetrahydro(benzo[1,2-b:5,4-b′]difuran)-3-yl}-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 205440-11-5
| CASNo_Ref = {{cascite|correct|}}
| ChemSpiderID = 57539156
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8256ST4BZK
| PubChem = 71308201
| StdInChI=1S/C56H42O11/c57-35-13-4-29(5-14-35)6-21-44-51-46(66-55(31-9-17-37(59)18-10-31)49(51)34-24-41(63)27-42(64)25-34)28-47-52(44)53(56(67-47)32-11-19-38(60)20-12-32)43-2-1-3-45-50(43)48(33-22-39(61)26-40(62)23-33)54(65-45)30-7-15-36(58)16-8-30/h1-28,48-49,53-64H/b21-6+/t48-,49-,53+,54+,55+,56-/m1/s1
| StdInChIKey = AZTITUGYPXKUCV-CGOOCLRTSA-N
| SMILES = OC1=CC([C@H]2[C@H](C3=CC=C(O)C=C3)OC4=CC5=C([C@@](C6=CC=CC7=C6[C@@H](C8=CC(O)=CC(O)=C8)[C@H](C9=CC=C(O)C=C9)O7)([H])[C@@H](C%10=CC=C(O)C=C%10)O5)C(/C=C/C%11=CC=C(O)C=C%11)=C42)=CC(O)=C1
| ChemSpiderID_Ref =
| MeSHName =
}}
|Section2={{Chembox Properties
| C=56 | H=42 | O=12
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| GHS_ref=
}}
}}
Flexuosol A is a resveratrol tetramer found in Vitis flexuosa.{{cite journal | doi = 10.1021/np970457v | title = Flexuosol A, a New Tetrastilbene fromVitis flexuosa | year = 1998 | last1 = Li | first1 = Wen-wu | last2 = Li | first2 = Bo-Gang | last3 = Chen | first3 = Yao-zu | journal = Journal of Natural Products | volume = 61 | issue = 5 | pages = 646–7 | pmid = 9599267}}
References
{{reflist}}
{{Oligostilbenoid}}
Category:Resveratrol oligomers
Category:Natural phenol tetramers
{{aromatic-stub}}