Florantyrone

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444406607

| IUPAC_name = 4-fluoranthen-8-yl-4-oxobutanoic acid

| image = Florantyrone.png

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 519-95-9

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 10617

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB08975

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UZ5LMI200P

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10172

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2106357

| chemical_formula =

| C=20 | H=14 | O=3

| smiles = C1=CC2=C3C(=C1)C4=C(C3=CC=C2)C=C(C=C4)C(=O)CCC(=O)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C20H14O3/c21-18(9-10-19(22)23)13-7-8-14-15-5-1-3-12-4-2-6-16(20(12)15)17(14)11-13/h1-8,11H,9-10H2,(H,22,23)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QOBAOSCOLAGPKI-UHFFFAOYSA-N

| melting_point = 195

| solubility = soluble in methanol, ethanol, sodium carbonate

}}

Florantyrone (INN; also known as fluorantyrone) is a drug used in the treatment of biliary dyskinesia.{{cite journal | vauthors = McHardy G | title = Postcholecystectomy syndrome | journal = Disease-a-Month | volume = 1 | issue = | pages = 40 | date = September 1959 | pmid = 13858508 | doi = 10.1016/S0011-5029(59)80012-2 }} It is also known as a cholagogue and choleretic.{{cite web|title=florantyrone - Compound Summary|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?q=all&cid=10617|publisher=PubChem Compound - National Center for Biotechnology Information|accessdate=15 November 2011}}

It is manufactured from fluoranthene and succinic anhydride in the presence of aluminum chloride in a nitrobenzene solution. (US PATENT 2,560,425 (1951 To Miles Lab)).

References

Category:Laxatives