Flucindole

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 444385042

| IUPAC_name = 6,8-Difluoro-N,N-dimethyl-2,3,4,9-tetrishydro-1H-carbazol-3-amine

| image = Flucindole.svg

| width =

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 40594-09-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 38531

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 35315

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5CYU0D0S8M

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02658

| ChEMBL = 1882682

| synonyms = WIN-35150; WIN35150; WIN-35,150; 5,7-Difluoro-N,N-dimethyl-α,2-dimethylene-tryptamine

| C = 14 | H = 16 | F = 2 | N = 2

| SMILES = CN(C)C1CCC2=C(C1)C3=CC(=CC(=C3N2)F)F

| StdInChI = 1S/C14H16F2N2/c1-18(2)9-3-4-13-10(7-9)11-5-8(15)6-12(16)14(11)17-13/h5-6,9,17H,3-4,7H2,1-2H3

| StdInChIKey = FXNCRITWFOVSEP-UHFFFAOYSA-N

}}

Flucindole ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|USAN|United States Adopted Name}}; developmental code name WIN-35150) is an antipsychotic with a tricyclic and tryptamine-like structure that was never marketed.{{cite book | last=Elks | first=J. | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA556 | access-date=2 November 2024 | page=556}}{{cite journal | vauthors = Wood PL, McQuade PS | title = Ciclindole and flucindole: novel tetrahydrocarbazolamine neuroleptics | journal = Progress in Neuro-Psychopharmacology & Biological Psychiatry | volume = 8 | issue = 4–6 | pages = 773–7 | year = 1984 | pmid = 6152347 | doi = 10.1016/0278-5846(84)90057-5 | s2cid = 39252411 }} It is the 6,8-difluoro derivative of ciclindole.{{cite journal | vauthors = Edelson J, Benziger DP | title = Disposition of a series of tetrahydrocarbazoles | journal = Drug Metabolism Reviews | volume = 11 | issue = 2 | pages = 263–89 | year = 1980 | pmid = 7011760 | doi = 10.3109/03602538008994027 }} The drug is about 5 to 10{{nbsp}}times more potent than ciclindole both in vitro and in vivo.