Flugestone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one

| image = Flugestone.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 337-03-1

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 254765

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 223326

| UNII = NT3ET34748

| KEGG = D07968

| C=21 | H=29 | F=1 | O=4

| smiles = CC(=O)C1(CCC2C1(CC(C3(C2CCC4=CC(=O)CCC43C)F)O)C)O

| StdInChI_Ref =

| StdInChI = 1S/C21H29FO4/c1-12(23)20(26)9-7-15-16-5-4-13-10-14(24)6-8-18(13,2)21(16,22)17(25)11-19(15,20)3/h10,15-17,25-26H,4-9,11H2,1-3H3/t15-,16-,17-,18-,19-,20-,21-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = OFSXGKOMEGSTSE-BPSSIEEOSA-N

| synonyms =

}}

Flugestone (INN, BAN), also known as flurogestone, as well as 9α-fluoro-11β,17α-dihydroxyprogesterone, is a steroidal progestin of the 17α-hydroxyprogesterone group that was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA559|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=559–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA451|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=451–}} An acetate ester, flurogestone acetate, is used in veterinary medicine.