Fluoroether E-1

{{Chembox

| ImageFile = File:Heptafluorpropyl-1,2,2,2-tetrafluorethylether.svg

| ImageSize = 220px

| ImageFile2 =

| ImageSize2 =

| PIN =

| OtherNames = heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether, secondary hydrogen endcap

| IUPACName =

| Section1 = {{Chembox Identifiers

| SMILES = C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F

| InChI = InChI=1S/C5HF11O/c6-1(2(7,8)9)17-5(15,16)3(10,11)4(12,13)14/h1H

| CASNo = 3330-15-2

| ChemSpiderID = 85066

| EINECS = 236-236-8

| PubChem = 94258

}}

| Section2 = {{Chembox Properties

|Appearance = Colourless liquid

| Density = 1.538/cm³ (at 20 °C)

| MeltingPtC =

| BoilingPtC = 40-42

| Solubility =

| pKa =

| C=5|H=1|F=11|O=1

}}

| Section7 = {{Chembox Hazards

| GHS_ref={{cite web |title=Heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether |url=https://pubchem.ncbi.nlm.nih.gov/compound/94258#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| PPhrases = {{P-phrases|261|264|264+265|271|280|302+352|304+340|305+351+338|319|321|332+317|337+317|362+364|403+233|405|501}}

| HPhrases = {{H-phrases|302|314|335}}

|ExternalSDS = [https://www.matrixscientific.com/media/msds/00/61/34/MxMSDS_006134.pdf]

|NFPA-H = 3

|NFPA-F = 2

|NFPA-R = 0

|FlashPt =

}}

}}

Fluoroether E-1 (known chemically as heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether, is a chemical compound that is among the class of per- and polyfluoroalkyl substances (PFAS). This synthetic fluorochemical is used in the GenX process, and may arise from the degradation of GenX chemicals including FRD-903.{{Cite journal |last1=Zhang |first1=Chuhui |last2=McElroy |first2=Amie C. |last3=Liberatore |first3=Hannah K. |last4=Alexander |first4=Nancy Lee M. |last5=Knappe |first5=Detlef R.U. |date=2022-05-17 |title=Stability of Per- and Polyfluoroalkyl Substances in Solvents Relevant to Environmental and Toxicological Analysis |journal=Environmental Science & Technology |volume=56 |issue=10 |pages=6103–6112 |doi=10.1021/acs.est.1c03979 |issn=0013-936X |pmc=9065217 |pmid=34734715|bibcode=2022EnST...56.6103Z }}{{cite journal |last1=Wickersham |first1=Lindsay |title=Characterization of PFAS air emissions from thermal application of fluoropolymer dispersions on fabrics |journal=Journal of the Air & Waste Management Association |date=10 March 2023 |volume=73 |issue=7 |pages=533–552 |doi=10.1080/10962247.2023.2192009 |pmid=36947591 |pmc=10628852 |bibcode=2023JAWMA..73..533W }}