Fluroxypyr

{{Chembox

| ImageFile = Fluroxypyr.svg

| ImageSize = 200px

| PIN = [(4-Amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetic acid

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 69377-81-7

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1 = 81406-37-3

| CASNo1_Comment = (1-Methylheptyl ester)

| CASNo1_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8O40SHO197

| UNII1 = 9W47M4YJ3Q

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1_Comment = (1-Methylheptyl ester)

| PubChem = 50465

| ChemSpiderID = 45757

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 82017

| SMILES = Fc1nc(OCC(=O)O)c(Cl)c(c1Cl)N

| InChI = 1/C7H5Cl2FN2O3/c8-3-5(11)4(9)7(12-6(3)10)15-1-2(13)14/h1H2,(H2,11,12)(H,13,14)

| InChIKey = MEFQWPUMEMWTJP-UHFFFAOYAO

| StdInChI = 1S/C7H5Cl2FN2O3/c8-3-5(11)4(9)7(12-6(3)10)15-1-2(13)14/h1H2,(H2,11,12)(H,13,14)

| StdInChIKey = MEFQWPUMEMWTJP-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=7|H=5|Cl=2|F=1|N=2|O=3

| Appearance = White solid{{GESTIS|ZVG=530261}}

| Density = 1,09 g/cm3 (20 °C)

| MeltingPtC = 232 to 233

| MeltingPt_ref =

| BoilingPt =

| Solubility = 91 mg/L (20 °C)

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Fluroxypyr is an herbicide in the class of synthetic auxins. It is used to control broadleaf weeds and woody brush.{{Cite journal | title = Fluroxypyr: Roadside Vegetation Management Herbicide Fact Sheet | publisher = Washington State Department of Transportation | url = http://www.wsdot.wa.gov/NR/rdonlyres/767D2219-C458-4CCA-A5DC-3F185580580F/0/fluroxypyr.pdf | date = February 2006 }} It is formulated as the 1-methylheptyl ester (fluroxypyr-MHE).{{cite journal | url = http://www.fs.fed.us/foresthealth/pesticide/pdfs/0521303a_fluroxypyr.pdf | title = Fluroxypyr Human Health and Ecological Risk Assessment | publisher = USDA Forest Service | date = June 12, 2009}}

References