Folpet
{{Chembox
| ImageFile = Folpet.png
| ImageSize =
| ImageAlt =
| PIN = 2-[(trichloromethyl)sulfanyl]-1H-isoindole-1,3(2H)-dione
| OtherNames = N-(Trichloromethylthio)phthalimide, Orthophaltan, Phaltan, Faltan, Folpan, Faltex, Folpex
|Section1={{Chembox Identifiers
| CASNo = 133-07-3
| ChemSpiderID = 8288
| PubChem = 8607
| EC_number = 205-088-6
| RTECS = TI5685000
| UNNumber = 3077 2588
| UNII = X5NFK36917
| ChEBI = 82019
| ChEMBL = 1883819
| KEGG = C18860
| StdInChI=1S/C9H4Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-4H
| StdInChIKey = HKIOYBQGHSTUDB-UHFFFAOYSA-N
| SMILES = C1=CC=C2C(=C1)C(=O)N(C2=O)SC(Cl)(Cl)Cl }}
|Section2={{Chembox Properties
| C=9|H=4|Cl=3|N=1|O=2|S=1
| MolarMass =
| Appearance = white solid
| Density = 1.72 g/cm3
| MeltingPtC = 177
| MeltingPt_notes = (decomp.)
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|317|319|332|351|400}}
| PPhrases = {{P-phrases|201|202|261|264|271|272|273|280|281|302+352|304+312|304+340|305+351+338|308+313|312|321|333+313|337+313|363|391|405|501}}
| FlashPt =
| AutoignitionPt = }}
}}
Folpet is the tradename for the organic compound with the formula C6H4(CO)2NSCCl3. It is a fungicide derived from phthalimide (C6H4(CO)2N-) and trichloromethylsulfenyl chloride. The compound is white although commercial samples can appear brownish. It is structurally related to Captan, which is also a trichloromethylsulfenyl-containing fungicide.{{cite encyclopedia |author=Franz Müller |author2=Peter Ackermann |author3=Paul Margot |title=Fungicides, Agricultural, 2. Individual Fungicides|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|publisher=Wiley-VCH|place=Weinheim|year=2012|doi=10.1002/14356007.o12_o06|isbn=978-3-527-30673-2 }}
Resistance
{{As of|December 2019}} folpet resistance is still unheard of due to its multiple effects. However, in 2001 some degree of cross-resistance was reported in iprodione-resistant South African Botrytis cinerea on grape.
References
{{reflist|refs=
{{cite web | title=Folpet: the essential multi-site fungicide | website=ADAMA UK | url=http://www.adama.com/uk/en/news-and-media/adama-news/folpet-the-essential-multi-site-fungicide | access-date=2021-03-13 | date=2019-12-11}}
{{cite journal | last1=Fourie | first1=P.H. | last2=Holz | first2=G. | title=Incomplete Cross-Resistance to Folpet and Iprodione in Botrytis cinerea from Grapevine in South Africa | journal=South African Journal of Enology & Viticulture | publisher=Stellenbosch University | volume=22 | issue=1 | year=2001 | issn=2224-7904 | doi=10.21548/22-1-2158 | page=3-7 | s2cid=56014315| doi-access=free }}
{{cite journal | last1=Bosch | first1=Frank van den | last2=Oliver | first2=Richard | last3=Berg | first3=Femke van den | last4=Paveley | first4=Neil | title=Governing Principles Can Guide Fungicide-Resistance Management Tactics | journal=Annual Review of Phytopathology | publisher=Annual Reviews | volume=52 | issue=1 | date=2014-08-04 | issn=0066-4286 | doi=10.1146/annurev-phyto-102313-050158 | pages=175–195 | s2cid=36554883 | pmid=24848413| doi-access=free }}
}}
Category:Aldehyde dehydrogenase inhibitors