Foslevodopa

{{Short description|Chemical compound}}

{{Use dmy dates|date=October 2024}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| image = Foslevodopa.svg

| width = 200

| alt =

| tradename =

| routes_of_administration =

| CAS_number = 97321-87-4

| PubChem = 127766

| DrugBank = DB16683

| ChemSpiderID = 113330

| UNII = 37NQZ0J76I

| KEGG = D11839

| ChEBI = 192509

| ChEMBL = 4594379

| IUPAC_name = (2S)-2-Amino-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid

| C=9 | H=12 | N=1 | O=7 | P=1

| StdInChI = 1S/C9H12NO7P/c10-6(9(12)13)3-5-1-2-8(7(11)4-5)17-18(14,15)16/h1-2,4,6,11H,3,10H2,(H,12,13)(H2,14,15,16)/t6-/m0/s1

| StdInChIKey = YNDMEEULGSTYJT-LURJTMIESA-N

| SMILES = C1=CC(=C(C=C1C[C@@H](C(=O)O)N)O)OP(=O)(O)O

}}

Foslevodopa is a medication which acts as a prodrug for levodopa, originally invented in the 1980s but not developed for medical use at that time.{{cite journal | vauthors = Agin PP, Sayre RM, Pawelek JM | title = Phosphorylated mixed isomers of L-dopa increase melanin content in skins of Skh-2 pigmented hairless mice | journal = Pigment Cell Research | date = 1987 | volume = 1 | issue = 3 | pages = 137–142 | pmid = 3149738 | doi = 10.1111/j.1600-0749.1987.tb00404.x }} It is approved for use in a subcutaneous infusion as a fixed-dose combination with foscarbidopa for the treatment of Parkinson's disease, under the brand name Vyalev.{{cite journal | vauthors = Poplawska-Domaszewicz K, Batzu L, Falup-Pecurariu C, Chaudhuri KR | title = Subcutaneous Levodopa: A New Engine for the Vintage Molecule | journal = Neurology and Therapy | volume = 13 | issue = 4 | pages = 1055–1068 | date = August 2024 | pmid = 38874708 | doi = 10.1007/s40120-024-00635-4 | pmc = 11263521 }}{{cite journal | vauthors = Fung VS, Aldred J, Arroyo MP, Bergquist F, Boon AJ, Bouchard M, Bray S, Dhanani S, Facheris MF, Fisseha N, Freire-Alvarez E, Hauser RA, Jeong A, Jia J, Kukreja P, Soileau MJ, Spiegel AM, Talapala S, Tarakad A, Urrea-Mendoza E, Zamudio J, Pahwa R | title = Continuous subcutaneous foslevodopa/foscarbidopa infusion for the treatment of motor fluctuations in Parkinson's disease: Considerations for initiation and maintenance | journal = Clinical Parkinsonism & Related Disorders | date = 2024 | volume = 10 | pages = 100239 | pmid = 38419617 | doi = 10.1016/j.prdoa.2024.100239 | pmc = 10900117 }}