Fosopamine

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Fosopamine.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration = Oral

| class = Dopamine receptor agonist

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 103878-96-2

| CAS_supplemental =

| PubChem = 65878

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 59287

| UNII = 50Q2Q042YR

| KEGG =

| ChEBI =

| ChEMBL = 2104671

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Fosfenamine; N-Methyldopamine 4-O-phosphate; Epinine 4-O-phosphate; SIM-2055; Z-2055

| IUPAC_name = [2-hydroxy-4-[2-(methylamino)ethyl]phenyl] dihydrogen phosphate

| C=9 | H=14 | N=1 | O=5 | P=1

| SMILES = CNCCC1=CC(=C(C=C1)OP(=O)(O)O)O

| StdInChI = 1S/C9H14NO5P/c1-10-5-4-7-2-3-9(8(11)6-7)15-16(12,13)14/h2-3,6,10-11H,4-5H2,1H3,(H2,12,13,14)

| StdInChIKey = WHEGQKBWPSOMHG-UHFFFAOYSA-N

}}

Fosopamine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code names SIM-2055, Z-2055; also known as fosfenamine or N-methyldopamine 4-O-phosphate) is a dopamine receptor agonist of the phenethylamine and catecholamine families which was under development for the treatment of hypertension but was never marketed.{{cite web | title=Fosopamine | website=AdisInsight | date=7 April 1999 | url=https://adisinsight.springer.com/drugs/800002585 | access-date=27 February 2025}}{{cite book | vauthors = Negwer M | title=Organic-chemical Drugs and Their Synonyms: (an International Survey) | publisher=Akademie Verlag | year=1994 | isbn=978-3-05-500156-7 | url=https://books.google.com/books?id=1ghtAAAAMAAJ | access-date=27 February 2025 | page=}} It is taken orally. Fosopamine is a prodrug of epinine (N-methyldopaine) and is said to be selectively metabolized into epinine in the kidneys.{{cite book | vauthors = Supuran C, Angeli A, Tanini D | title=Advances in Prodrugs: Design and Therapeutic Applications | publisher=Elsevier | year=2024 | isbn=978-0-443-15634-2 | url=https://books.google.com/books?id=R8TnEAAAQBAJ&pg=PA296 | access-date=27 February 2025 | page=296}} The drug was being developed by AstraZeneca and Zambon Group SpA. It reached phase 2 clinical trials prior to the discontinuation of its development.