Friulimicin

{{Chembox

| Name = Friulimicin B

| ImageFile = Friulimicin B.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName =

| OtherNames = Friulimycin B

| Section1 = {{Chembox Identifiers

| CASNo = 239802-15-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = AYO43961I1

| PubChem = 56842195

| ChemSpiderID = 32699135

| SMILES = C[C@H]1[C@@H](C(=O)N2CCCC[C@@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)N[C@@H](C(=O)N[C@H](C(=O)N3CCC[C@H]3C(=O)N1)C(C)C)[C@@H](C)N)CC(=O)O)CC(=O)O)[C@H](C)C(=O)O)NC(=O)[C@H](CC(=O)N)NC(=O)C/C=C\CCCCCCCC(C)C

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1688547

| InChI=1S/C59H94N14O19/c1-30(2)19-14-12-10-8-9-11-13-15-22-41(75)65-35(25-40(61)74)52(84)71-49-34(7)64-53(85)39-21-18-24-73(39)57(89)46(31(3)4)69-56(88)48(33(6)60)68-43(77)29-63-50(82)36(26-44(78)79)66-42(76)28-62-51(83)37(27-45(80)81)67-55(87)47(32(5)59(91)92)70-54(86)38-20-16-17-23-72(38)58(49)90/h13,15,30-39,46-49H,8-12,14,16-29,60H2,1-7H3,(H2,61,74)(H,62,83)(H,63,82)(H,64,85)(H,65,75)(H,66,76)(H,67,87)(H,68,77)(H,69,88)(H,70,86)(H,71,84)(H,78,79)(H,80,81)(H,91,92)/b15-13-/t32-,33+,34-,35-,36-,37-,38+,39-,46-,47-,48+,49-/m0/s1

| InChIKey = HVYFVLAUKMGKHL-USKUEUQVSA-N

}}

| Section2 = {{Chembox Properties

| C=59|H=94|N=14|O=19

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Friulimicin B is a lipopeptide antibiotic produced by Actinoplanes friuliensis. It includes the unusual amino acid methylaspartate.{{Cite journal | doi = 10.1128/AAC.47.2.447-457.2003| pmid = 12543643| title = A Glutamate Mutase is Involved in the Biosynthesis of the Lipopeptide Antibiotic Friulimicin in Actinoplanes friuliensis| journal = Antimicrobial Agents and Chemotherapy| volume = 47| issue = 2| pages = 447–57| year = 2003| last1 = Heinzelmann | first1 = E.| last2 = Berger | first2 = S.| last3 = Puk | first3 = O.| last4 = Reichenstein | first4 = B.| last5 = Wohlleben | first5 = W.| last6 = Schwartz | first6 = D. | pmc=151761}}