Fumigaclavine B

{{more citations needed|date=January 2014}}

{{Chembox

| ImageFile = Fumigaclavine B 2.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName =

| OtherNames = (8β,9β)-6,8-Dimethylergolin-9-ol

|Section1={{Chembox Identifiers

| CASNo = 6879-93-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = TBQ33F7DSR

| ChEBI = 67156

| ChEMBL = 2229125

| KEGG = C20437

| PubChem = 21589072

| ChemSpiderID = 28533139

| StdInChI=1S/C16H20N2O/c1-9-8-18(2)13-6-10-7-17-12-5-3-4-11(14(10)12)15(13)16(9)19/h3-5,7,9,13,15-17,19H,6,8H2,1-2H3/t9-,13-,15-,16+/m1/s1

| StdInChIKey = JUXRVSRUBIFVKE-BBDZHYCFSA-N

| SMILES = C[C@H]1CN([C@@H]2Cc3c[nH]c4c3c(ccc4)[C@H]2[C@H]1O)C

}}

|Section2={{Chembox Properties

| C=16 | H=20 | N=2 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Fumigaclavine B is an ergoline compound made by certain fungi.

Both 8α and 8β diastereomers (epimers) were named fumigaclavine B in scientific literature.{{Cite journal| doi = 10.1039/C0NP00060D| pmid = 21186384| issn = 1460-4752| volume = 28| issue = 3| pages = 496–510| last1 = Wallwey| first1 = Christiane| last2 = Li| first2 = Shu-Ming| title = Ergot alkaloids: structure diversity, biosynthetic gene clusters and functional proof of biosynthetic genes| journal = Natural Product Reports| date = 2011-03-01}}