Fusarubin
{{Chembox
| ImageFile = Fusarubin.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 3,5,10-trihydroxy-7-methoxy-3-methyl-1,4-dihydrobenzo[g]isochromene-6,9-dione
| OtherNames = Oxyjavanicin{{cite journal |title=Fusarubin |journal=Pubchem.ncbi.NLM.nih.gov |url=https://pubchem.ncbi.nlm.nih.gov/compound/Fusarubin |language=en}}
| Section1 = {{Chembox Identifiers
| CASNo = 1702-77-8
| CASNo_Ref = {{Cascite|correct|CAS}}
| ChEBI =
| ChEMBL = 1224816
| ChemSpiderID = 66134
| EINECS =
| PubChem = 73421
| UNII = 7O2VQR7EHB
| StdInChI=1S/C15H14O7/c1-15(20)4-6-7(5-22-15)13(18)10-8(16)3-9(21-2)14(19)11(10)12(6)17/h3,17-18,20H,4-5H2,1-2H3
| StdInChIKey = FKJXMYJPOKQPSS-UHFFFAOYSA-N
| SMILES = CC1(CC2=C(CO1)C(=C3C(=O)C=C(C(=O)C3=C2O)OC)O)O
}}
| Section2 = {{Chembox Properties
| C=15 | H=14 | O=7
| Density =
| Appearance =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Fusarubin is a naphthoquinone derived mycotoxin which is produced by the fungi Fusarium solani.{{cite book |last1=Bycroft |first1=Barrie W. |last2=Payne |first2=David J. |title=Dictionary of Antibiotics and Related Substances: with CD-ROM, Second Edition |date=9 August 2013 |publisher=CRC Press |isbn=978-1-4822-8215-3 |page=858 |language=en}}{{cite book |last1=Buckingham |first1=John |title=Dictionary of Organic Compounds |date=1987 |publisher=Taylor & Francis |isbn=978-0-412-17050-8 |page=345 |language=en}} Fusarubin has the molecular formula C15H14O7.
== References ==
{{reflist}}
Further reading
{{refbegin}}
- {{cite journal |last1=Pedersen |first1=Tobias Bruun |last2=Nielsen |first2=Mikkel Rank |last3=Kristensen |first3=Sebastian Birkedal |last4=Spedtsberg |first4=Eva Mie Lang |last5=Yasmine |first5=Wafaa |last6=Matthiesen |first6=Rikke |last7=Kaniki |first7=Samba Evelyne Kabemba |last8=Sørensen |first8=Trine |last9=Petersen |first9=Celine |last10=Muff |first10=Jens |last11=Sondergaard |first11=Teis Esben |last12=Nielsen |first12=Kåre Lehmann |last13=Wimmer |first13=Reinhard |last14=Sørensen |first14=Jens Laurids |title=Heterologous Expression of the Core Genes in the Complex Fusarubin Gene Cluster of Fusarium Solani |journal=International Journal of Molecular Sciences |date=14 October 2020 |volume=21 |issue=20 |pages=7601 |doi=10.3390/ijms21207601|pmid=33066643 |pmc=7589453 |doi-access=free }}
{{refend}}
{{organic-compound-stub}}