G418

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461115152

| ImageFile = G418.svg

| ImageSize = 160

| IUPACName = (1S,2S,3R,4S,6R)-4,6-Diamino-2-hydroxycyclohexane-1,3-diyl 1-(3-amino-3-deoxy-4-C-methyl-β-L-arabinopyranoside) 3-(2-amino-2,7-dideoxy-D-glycero-α-D-gluco-heptopyranoside)

| SystematicName = (2R,3S,4R,5R,6S)-5-Amino-6-{[(1R,2S,3S,4R,6S)-4,6-diamino-3-{[(2R,3R,4R,5R)-3,5-dihydroxy-5-methyl-4-(methylamino)oxan-2-yl]oxy}-2-hydroxycyclohexyl]oxy}-2-[(1R)-1-hydroxyethyl]oxane-3,4-diol

| OtherNames = Geneticin
O-2-Amino-2,7-didesoxy-D-glycero-α-D-gluco-heptopyranosyl-(1→4)-O-(3-desoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyl- (1→6))-D-streptamin

|Section1={{Chembox Identifiers

| Abbreviations =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106441

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 215226

| InChI = 1/C20H40N4O10/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19/h6-19,24-30H,4-5,21-23H2,1-3H3/t6-,7-,8+,9+,10+,11-,12-,13+,14?,15+,16-,17+,18+,19+,20-/m0/s1

| InChIKey = BRZYSWJRSDMWLG-NQRKCNNJBI

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H40N4O10/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19/h6-19,24-30H,4-5,21-23H2,1-3H3/t6-,7-,8+,9+,10+,11-,12-,13+,14?,15+,16-,17+,18+,19+,20-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BRZYSWJRSDMWLG-NQRKCNNJSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 49863-47-0

| CASNo1_Ref = {{cascite|changed|CAS}}

| CASNo1 = 108321-42-2

| CASNo1_Comment = (disulfate salt)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A08F5XTI6G

| EINECS =

| PubChem = 123865

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB04263

| SMILES = O[C@H]3[C@H](O)[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]1OC[C@](C)(O)[C@H](NC)[C@H]1O)[C@H]2O)OC3[C@@H](O)C

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| C=20 | H=40 | N=4 | O=10

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = 50 mg/mL

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb = }}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape = }}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity = }}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US = }}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor = }}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = }}

}}

G418 (geneticin) is an aminoglycoside antibiotic similar in structure to gentamicin B1. It is produced by Micromonospora rhodorangea.{{cite web|title=Geneticin|url=https://www.thermofisher.com/us/en/home/life-science/cell-culture/transfection/selection/g418.html|work=Thermo Fisher Scientific|access-date=2017-08-07|archive-date=2017-08-08|archive-url=https://web.archive.org/web/20170808034522/https://www.thermofisher.com/us/en/home/life-science/cell-culture/transfection/selection/g418.html|url-status=live}} G418 blocks polypeptide synthesis by inhibiting the elongation step in both prokaryotic and eukaryotic cells. Resistance to G418 is conferred by the neo gene from Tn5 encoding an aminoglycoside 3'-phosphotransferase, APT 3' II. G418 is an analog of neomycin sulfate, and has similar mechanism as neomycin. G418 is commonly used in laboratory research to select genetically engineered cells .{{cite web|url=http://www.exactantigen.com/review/G418.html|title=G418|accessdate=2010-01-09|work=labome.com|archive-url=https://web.archive.org/web/20091229191551/http://www.exactantigen.com/review/G418.html|archive-date=2009-12-29|url-status=dead}} In general, for bacteria and algae, concentrations of 5 μg/mL or less are used; for mammalian cells, concentrations of approximately 400 μg/mL are used for selection and 200 μg/mL for maintenance. However, optimal concentration for resistant clones selection in mammalian cells depends on the cell line used as well as on the plasmid carrying the resistance gene. Therefore, antibiotic titration should be done to find the best condition for every experimental system. Titration should be done using antibiotic concentrations ranging from 100 μg/mL up to 1400 μg/mL. Resistant clones selection could require from 1 to up to 3 weeks.{{cn|date=March 2023}}

__TOC__

G418 impurity profile

G418 is produced by fermentation and isolation processes and the G418 producing strain Micromonospora rhodorangea produces many other gentamicins while producing G418. The common impurities of G418 include gentamicins A, C1, C1a, C2, C2a and X2.{{Cite web |url=http://www.g418-evopure.com/structures.html |title=G418 impurity profile |access-date=2011-10-03 |archive-date=2016-03-03 |archive-url=https://web.archive.org/web/20160303233452/http://www.g418-evopure.com/structures.html |url-status=dead }} The quality of G418 is not based on just the potency, but more on the selectivity defined by the killing curve of the sensitive cells vs the resistant cells. A good G418 product has the lowest {{LD50}} for sensitive cells (such as NIH 3T3) and the highest LD50 (can be up to 5,000 μg/ml) for resistant cells (NIH 3T3 transfected with resistant genes). Gentamicins have almost no selectivity, except gentamicin X2.{{Cite web |url=http://www.g418-evopure.com/Technical.html |title=G418 selectivity |access-date=2011-07-14 |archive-date=2016-02-05 |archive-url=https://web.archive.org/web/20160205024043/http://g418-evopure.com/Technical.html |url-status=dead }}

Use in cell biology

G418 is routinely used as a selective agent in cell culture set-ups. Researchers can link the neoR selective resistance gene with their vector. Then if the vector is successfully introduced into cells, the cells can become G418-resistant cells. After treating with G418, these vector(-) cells will die, while vector(+) cells will survive. This method can help researchers select vector(+) cells.{{cite book|year=2013|title=Molecular Cell Biology|section=Chapter5: Molecular Genetic Techniques|publisher=Macmillan Higher Education|author=Harvey Lodish|display-authors=etal|isbn=978-1-4641-0981-2|pages=171–223 |edition=7th }}

Mechanism of action

G418 Disulfate and other aminoglycosides prevent protein synthesis at the early stages of elongation, post-initiation, initiation of translation. Resistance to G418 Disulfate is conferred by the Neomycin resistance gene (neo) from either Tn5 or Tn601 (903) transposons. Cells transfected with resistance plasmids containing the neo gene can express aminoglycoside 3'-phosphotransferase (APT 3' I or APT 3' II) which covalently modifies G418 to 3-phosphoric G418,  which has negligible potency and has low-affinity for prokaryotic and eukaryotic ribosomes.{{Cite web |title=G418 Disulfate |url=https://toku-e.com/g418-disulfate/ |access-date=2024-06-28 |website=TOKU-E |language=en}}

References