GAT100

{{short description|Chemical compound; modulator of the cannabinoid CB1 receptor}}

{{Drugbox

| verifiedrevid =

| IUPAC_name = 3-ethyl-5-isothiocyanato-N-(4-(piperidin-1-yl)phenethyl)-1H-indole-2-carboxamide

| image = GAT100_structure.png

| tradename =

| legal_status =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand =

| CAS_number = 1663564-42-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = JA6FTF7C5A

| PubChem =

| ChemSpiderID = 58145179

| C=25 | H=28 | N=4 | O=1 | S=1

| molecular_weight =

| smiles = CCc1c([nH]c2ccc(cc12)N=C=S)C(=O)NCCc3ccc(cc3)N4CCCCC4

| StdInChI = 1S/C25H28N4OS/c1-2-21-22-16-19(27-17-31)8-11-23(22)28-24(21)25(30)26-13-12-18-6-9-20(10-7-18)29-14-4-3-5-15-29/h6-11,16,28H,2-5,12-15H2,1H3,(H,26,30)

| StdInChIKey = YIYLMDVRSNXYOT-UHFFFAOYSA-N

}}

GAT100 is a negative allosteric modulator of the cannabinoid CB₁ receptor.{{cite journal | vauthors = Kulkarni PM, Kulkarni AR, Korde A, Tichkule RB, Laprairie RB, Denovan-Wright EM, Zhou H, Janero DR, Zvonok N, Makriyannis A, Cascio MG, Pertwee RG, Thakur GA | display-authors = 6 | title = Novel Electrophilic and Photoaffinity Covalent Probes for Mapping the Cannabinoid 1 Receptor Allosteric Site(s) | journal = Journal of Medicinal Chemistry | volume = 59 | issue = 1 | pages = 44–60 | date = January 2016 | pmid = 26529344 | pmc = 4716578 | doi = 10.1021/acs.jmedchem.5b01303 |author-link10= Alexandros Makriyannis }}{{cite journal | vauthors = Laprairie RB, Kulkarni AR, Kulkarni PM, Hurst DP, Lynch D, Reggio PH, Janero DR, Pertwee RG, Stevenson LA, Kelly ME, Denovan-Wright EM, Thakur GA | display-authors = 6 | title = Mapping Cannabinoid 1 Receptor Allosteric Site(s): Critical Molecular Determinant and Signaling Profile of GAT100, a Novel, Potent, and Irreversibly Binding Probe | journal = ACS Chemical Neuroscience | volume = 7 | issue = 6 | pages = 776–98 | date = June 2016 | pmid = 27046127 | pmc = 5358098 | doi = 10.1021/acschemneuro.6b00041 }}