GLPG-0492

{{Short description|Medication}}

{{Drugbox

| IUPAC_name = 4-[(4R)-4-(hydroxymethyl)-3-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile

| image = GLPG-0492.svg

| tradename =

| legal_US = Investigational new drug

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1215085-93-0

| PubChem = 59317173

| UNII =

| ChemSpiderID = 28669946

| ChEMBL = 2178101

| C=19 | H=14 | F=3 | N=3 | O=3

| SMILES = CN1C(=O)N(C(=O)[C@]1(CO)C2=CC=CC=C2)C3=CC(=C(C=C3)C#N)C(F)(F)F

| StdInChI= 1S/C19H14F3N3O3/c1-24-17(28)25(14-8-7-12(10-23)15(9-14)19(20,21)22)16(27)18(24,11-26)13-5-3-2-4-6-13/h2-9,26H,11H2,1H3/t18-/m0/s1

| StdInChIKey = VAJGULUVTFDTAS-SFHVURJKSA-N

}}

GLPG-0492 (DT-200) is a drug which acts as a selective androgen receptor modulator (SARM). It has been investigated for the treatment of cachexia and muscular dystrophy.{{cite journal | vauthors = Nique F, Hebbe S, Triballeau N, Peixoto C, Lefrançois JM, Jary H, Alvey L, Manioc M, Housseman C, Klaassen H, Van Beeck K, Guédin D, Namour F, Minet D, Van der Aar E, Feyen J, Fletcher S, Blanqué R, Robin-Jagerschmidt C, Deprez P | display-authors = 6 | title = Identification of a 4-(hydroxymethyl)diarylhydantoin as a selective androgen receptor modulator | journal = Journal of Medicinal Chemistry | volume = 55 | issue = 19 | pages = 8236–8247 | date = October 2012 | pmid = 22957947 | doi = 10.1021/jm300281x }}{{cite journal | vauthors = Cozzoli A, Capogrosso RF, Sblendorio VT, Dinardo MM, Jagerschmidt C, Namour F, Camerino GM, De Luca A | display-authors = 6 | title = GLPG0492, a novel selective androgen receptor modulator, improves muscle performance in the exercised-mdx mouse model of muscular dystrophy | journal = Pharmacological Research | volume = 72 | pages = 9–24 | date = June 2013 | pmid = 23523664 | doi = 10.1016/j.phrs.2013.03.003 | hdl = 11586/62855 }}{{cite journal | vauthors = Blanqué R, Lepescheux L, Auberval M, Minet D, Merciris D, Cottereaux C, Clément-Lacroix P, Delerive P, Namour F | display-authors = 6 | title = Characterization of GLPG0492, a selective androgen receptor modulator, in a mouse model of hindlimb immobilization | journal = BMC Musculoskeletal Disorders | volume = 15 | pages = 291 | date = September 2014 | pmid = 25185887 | doi = 10.1186/1471-2474-15-291 | pmc = 4167280 | doi-access = free }}{{cite journal | vauthors = Zierau O, Kolodziejczyk A, Vollmer G, Machalz D, Wolber G, Thieme D, Keiler AM | title = Comparison of the three SARMs RAD-140, GLPG0492 and GSK-2881078 in two different in vitro bioassays, and in an in silico androgen receptor binding assay | journal = The Journal of Steroid Biochemistry and Molecular Biology | volume = 189 | pages = 81–86 | date = May 2019 | pmid = 30825507 | doi = 10.1016/j.jsbmb.2019.02.014 | s2cid = 72334106 }}{{cite journal | vauthors = Fonseca GW, Dworatzek E, Ebner N, Von Haehling S | title = Selective androgen receptor modulators (SARMs) as pharmacological treatment for muscle wasting in ongoing clinical trials | journal = Expert Opinion on Investigational Drugs | volume = 29 | issue = 8 | pages = 881–891 | date = August 2020 | pmid = 32476495 | doi = 10.1080/13543784.2020.1777275 | s2cid = 219174372 }}{{cite journal | vauthors = Stacchini C, Botrè F, Comunità F, de la Torre X, Dima AP, Ricci M, Mazzarino M | title = Simultaneous detection of different chemical classes of selective androgen receptor modulators in urine by liquid chromatography-mass spectrometry-based techniques | journal = Journal of Pharmaceutical and Biomedical Analysis | volume = 195 | pages = 113849 | date = February 2021 | pmid = 33383501 | doi = 10.1016/j.jpba.2020.113849 | s2cid = 229941017 }}