GSK1702934A

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-[1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidin-4-yl]-1H-benzimidazol-2-one

| image = GSK1702934A_structure.png

| width = 220

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number = 924377-85-5

| PubChem = 16376051

| ChemSpiderID = 10981314

| ChEMBL =

| UNII =

| C=22 | H=25 | N=3 | O=2 | S=1

| smiles = C1CCC2=C(CC1)SC(=C2)C(=O)N3CCC(CC3)N4C5=CC=CC=C5NC4=O

| StdInChI = 1S/C22H25N3O2S/c26-21(20-14-15-6-2-1-3-9-19(15)28-20)24-12-10-16(11-13-24)25-18-8-5-4-7-17(18)23-22(25)27/h4-5,7-8,14,16H,1-3,6,9-13H2,(H,23,27)

| StdInChIKey = AXWRAIIIBRLXBP-UHFFFAOYSA-N

}}

GSK1702934A is a chemical compound which acts as an activator of the TRPC family of calcium channels, with selectivity for the TRPC3 and TRPC6 subtypes. It has been used to investigate the role of TRPC channels in heart function and regulation of blood pressure, as well as roles in the brain.{{cite journal | vauthors = Xu X, Lozinskaya I, Costell M, Lin Z, Ball JA, Bernard R, Behm DJ, Marino JP, Schnackenberg | title = CG Characterization of Small Molecule TRPC3 and TRPC6 agonist and Antagonists. | journal = Biophysical Journal | date = 2013 | volume = 104 | issue = 2 | pages = 454a | doi = 10.1016/j.bpj.2012.11.2513 | bibcode = 2013BpJ...104..454X | doi-access = free }}{{cite journal | vauthors = Doleschal B, Primessnig U, Wölkart G, Wolf S, Schernthaner M, Lichtenegger M, Glasnov TN, Kappe CO, Mayer B, Antoons G, Heinzel F, Poteser M, Groschner K | title = TRPC3 contributes to regulation of cardiac contractility and arrhythmogenesis by dynamic interaction with NCX1 | journal = Cardiovascular Research | volume = 106 | issue = 1 | pages = 163–73 | date = April 2015 | pmid = 25631581 | pmc = 4362401 | doi = 10.1093/cvr/cvv022 }}{{cite journal | vauthors = Tiapko O, Groschner K | title = TRPC3 as a Target of Novel Therapeutic Interventions | journal = Cells | volume = 7 | issue = 7 | date = July 2018 | page = 83 | pmid = 30037143 | pmc = 6071100 | doi = 10.3390/cells7070083 | doi-access = free }}{{cite journal | vauthors = Wang Y, Liu L, Tao H, Wen L, Qin S | title = TRPC6 participates in the development of blood pressure variability increase in sino-aortic denervated rats | journal = Heart and Vessels | volume = 35 | issue = 12 | pages = 1755–1765 | date = December 2020 | pmid = 32844288 | doi = 10.1007/s00380-020-01682-1 | s2cid = 221309937 }}