GSK417651A

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3,4-dihydro-1H-isoquinolin-2-yl-[2-(4-methoxyanilino)-1,3-thiazol-4-yl]methanone

| image = GSK417651A_structure.png

| width = 220

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 736945-96-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WV82DEG4YA

| PubChem = 1096735

| ChemSpiderID =

| ChEMBL =

| C=20 | H=19 | N=3 | O=2 | S=1

| smiles = COC1=CC=C(C=C1)NC2=NC(=CS2)C(=O)N3CCC4=CC=CC=C4C3

| StdInChI = 1S/C20H19N3O2S/c1-25-17-8-6-16(7-9-17)21-20-22-18(13-26-20)19(24)23-11-10-14-4-2-3-5-15(14)12-23/h2-9,13H,10-12H2,1H3,(H,21,22)

| StdInChIKey = NTXBDULODNTCKP-UHFFFAOYSA-N

}}

GSK417651A is a chemical compound which acts as a blocker of the TRPC family of calcium channels, with selectivity for the TRPC3 and TRPC6 subtypes. It has been used to investigate the role of TRPC3/6 channels in heart function.{{cite journal | vauthors = Xu X, Lozinskaya I, Costell M, Lin Z, Ball JA, Bernard R, Behm DJ, Marino JP, Schnackenberg | title = CG Characterization of Small Molecule TRPC3 and TRPC6 agonist and Antagonists. | journal = Biophysical Journal | date = 2013 | volume = 104 | issue = 2 | pages = 454a | doi = 10.1016/j.bpj.2012.11.2513 | bibcode = 2013BpJ...104..454X | doi-access = free }}{{cite journal | vauthors = Wen H, Gwathmey JK, Xie LH | title = Role of Transient Receptor Potential Canonical Channels in Heart Physiology and Pathophysiology | journal = Frontiers in Cardiovascular Medicine | year = 2020 | volume = 7 | pages = 24 | pmid = 32158769 | doi = 10.3389/fcvm.2020.00024 | pmc = 7052113 | doi-access = free }}{{cite journal | vauthors = Al-Shammari H, Latif N, Sarathchandra P, McCormack A, Rog-Zielinska EA, Raja S, Kohl P, Yacoub MH, Peyronnet R, Chester AH | display-authors = 6 | title = Expression and function of mechanosensitive ion channels in human valve interstitial cells | journal = PLOS ONE | year = 2020 | volume = 15 | issue = 10 | pages = e0240532 | pmid = 33057457 | doi = 10.1371/journal.pone.0240532 | pmc = 7561104 | bibcode = 2020PLoSO..1540532A | doi-access = free }}