Gadoxetic acid

{{Short description|Complex of gadolinium by a chelating agent derived from DTPA}}

{{Use dmy dates|date=July 2024}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 407826164

| image = Gadoxetic acid.png

| alt =

| USAN = Gadoxetate disodium

| tradename = Eovist

| Drugs.com = {{drugs.com|international|gadoxetic-acid}}

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration =

| ATC_prefix = V08

| ATC_suffix = CA10

| legal_AU =

| legal_CA = Rx-only

| legal_CA_comment = {{cite web | title=Product monograph brand safety updates | website=Health Canada | date=7 July 2016 | url=https://www.canada.ca/en/health-canada/services/drugs-health-products/drug-products/drug-product-database/label-safety-assessment-update/product-monograph-brand-safety-updates.html | access-date=13 July 2024}}

| legal_UK =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Eovist- gadoxetate disodium injection, solution | work = DailyMed | publisher = National Library of Medicine, National Institutes of Health, U.S. Health & Human Services | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=6218b1e1-cbc3-4c14-bec7-528ac163a561 | access-date=21 April 2021}}

| legal_EU = Rx-only

| legal_EU_comment = {{cite web | title = Active substance(s): gadoxetic acid disodium | work = List of nationally authorised medicinal products

| publisher = European Medicines Agency | date = 14 January 2021 | url = https://www.ema.europa.eu/documents/psusa/gadoxetic-acid-disodium-list-nationally-authorised-medicinal-products-psusa/00001509/202004_en.pdf}}

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPAC_name = 2-[[2-[bis(2-oxido-2-oxoethyl)amino]-3-(4-ethoxyphenyl)propyl]-[2-[bis(2-oxido-2-oxoethyl)amino]ethyl]amino]acetate; gadolinium(+3) cation

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 135326-11-3

| PubChem = 131704314

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08884

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 3QJA87N40S

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08008

| KEGG2 = D04288

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201768

| ChemSpiderID = 189907

| C=23 | H=30 | Gd=1 | N=3 | O=11

| smiles = CCOc1ccc(cc1)C[C@@H](CN(CCN(CC(=O)O)CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[Gd+3]

| StdInChI = 1S/C23H33N3O11.Gd/c1-2-37-18-5-3-16(4-6-18)9-17(26(14-22(33)34)15-23(35)36)10-24(11-19(27)28)7-8-25(12-20(29)30)13-21(31)32;/h3-6,17H,2,7-15H2,1H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36);/q;+3/p-3/t17-;/m0./s1

| StdInChIKey = PCZHWPSNPWAQNF-LMOVPXPDSA-K

}}

Gadoxetic acid is a gadolinium-based MRI contrast agent.{{cite journal | vauthors = Koh DM, Ba-Ssalamah A, Brancatelli G, Fananapazir G, Fiel MI, Goshima S, Ju SH, Kartalis N, Kudo M, Lee JM, Murakami T, Seidensticker M, Sirlin CB, Tan CH, Wang J, Yoon JH, Zeng M, Zhou J, Taouli B | display-authors = 6 | title = Consensus report from the 9th International Forum for Liver Magnetic Resonance Imaging: applications of gadoxetic acid-enhanced imaging | journal = European Radiology | volume = 31 | issue = 8 | pages = 5615–5628 | date = August 2021 | pmid = 33523304 | pmc = 8270799 | doi = 10.1007/s00330-020-07637-4 }} Its salt, gadoxetate disodium, is marketed as Primovist in Europe and Eovist in the United States by Bayer HealthCare Pharmaceuticals.{{cite web |url=http://imaging.bayerhealthcare.com/html/eovist/index.html |title=Eovist - Homepage |access-date=22 March 2009 |archive-date=25 April 2009 |archive-url=https://web.archive.org/web/20090425151035/http://imaging.bayerhealthcare.com/html/eovist/index.html |url-status=dead }}