Gallagic acid
{{chembox
| Watchedfields = changed
| verifiedrevid = 441161150
| Name = Gallagic acid
| ImageFile = Gallagic acid.svg
| ImageName = Chemical structure of gallagic acid
| PIN = 2,2′-(1,2,6,7-Tetrahydroxy-4,9-dioxo-4,9-dihydro-[1]benzopyrano[5,4,3-cde][1]benzopyran-3,8-diyl)bis(3,4,5-trihydroxybenzoic acid)
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 65995-62-2
| ChemSpiderID = 57568038
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TSN85LPS4R
| PubChem = 14754405
| StdInChI=1S/C28H14O18/c29-5-1-3(25(39)40)7(17(33)15(5)31)9-13-11-12-14(28(44)46-23(11)21(37)19(9)35)10(20(36)22(38)24(12)45-27(13)43)8-4(26(41)42)2-6(30)16(32)18(8)34/h1-2,29-38H,(H,39,40)(H,41,42)
| StdInChIKey = ZASJRRFAYSNSHU-UHFFFAOYSA-N
| SMILES = Oc4c6c1c(c5c(=O)o6)c(oc(=O)c1c(c4O)-c(c(O)c2O)c(C(O)=O)cc2O)c(O)c(O)c5-c3c(C(O)=O)cc(O)c(O)c3O
| InChI =
| MeSHName =
}}
|Section2={{Chembox Properties
| Formula = C28H14O18
| MolarMass = 638.39 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section8={{Chembox Related
| OtherCompounds = Gallagic acid dilactone; gallagyldilactone; terminalin
}}
}}
Gallagic acid is a polyphenolic chemical compound that can be found in the ellagitannins, a type of tannin, found in Punica granatum (pomegranate).Antioxidant, antimalarial and antimicrobial activities of tannin-rich fractions, ellagitannins and phenolic acids from Punica granatum L. Reddy Muntha K., Gupta Sashi K., Jacob Melissa R., Khan Shabana I. and Ferreira Daneel, Planta medica, 2007, vol. 73, no5, pp. 461-467, {{INIST|18773247}} It is a building block of the corresponding tannin punicalagin, punicalin, punicacortein C and 2-O-galloyl-punicalin.