Gallium acetate

{{chembox

| Name = Gallium acetate

| ImageFile = Gallium acetate.png

| ImageCaption =

| ImageName = Gallium acetate

| ImageFile1 =

| ImageName1 =

| ImageSize1 =

| ImageAlt1 =

| ImageCaption1 =

| IUPACNames = Tetra-μ²-acetatodiaquadigallium(III), diacetyloxygallanyl acetate

gallium(3+) triacetate

| OtherNames = {{Unbulleted list

| Gallium ethanoate

| Gallium triacetate

| Gallium(III) acetate

}}

| Section1 = {{Chembox Identifiers

| ChemSpiderID = 144647

| EC_number = 219-915-3

| CASNo = 2571-06-4

| PubChem = 16704853

| UNII =

| StdInChI=1S/3C2H4O2.Ga/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3

| StdInChIKey = FYWVTSQYJIPZLW-UHFFFAOYSA-K

| SMILES = CC(=O)O[Ga](OC(=O)C)OC(=O)C

}}

| Section2 = {{Chembox Properties

| Formula = Ga(O₂C₂H₃)₃

| MolarMass = 246.85{{Cite web | url=https://pubchem.ncbi.nlm.nih.gov/compound/Gallium-acetate | title=Gallium acetate }}

| Appearance = white crystals

| Density = 1.57 g/cm/³

| MeltingPt = N/A

| BoilingPt = 117.1C

| Solubility =

}}

| Section3 = {{Chembox Structure

| CrystalStruct =

| SpaceGroup =

}}

| Section4 = {{Chembox Hazards

| GHSPictograms = {{GHS05}}{{GHS07}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|314|335}}

| PPhrases = {{P-phrases|261|280|305+351+338|304+340|405|501}}

}}

}}

File:Acetate anion.png

Gallium acetate is a salt composed of a gallium atom trication and three acetate groups as anions where gallium exhibits the +3 oxidation state. It has a chemical formula of Ga(CH₃COO)₃ although it can be informally referred to as GaAc{{dubious|date=May 2025}} because Ac is an informal symbol for acetate. Gallium is moderately water-soluble and decomposes to gallium oxide when heated to around 70 °C. Gallium acetate, like other acetate compounds, is a good precursor to ultra-pure compounds, catalysts and nanoscale materials.{{Cite web |last=Elements |first=American |title=Gallium Acetate |url=https://www.americanelements.com/gallium-acetate-2571-06-4 |access-date=2022-05-05 |website=American Elements |language=en}} Gallium acetate is being considered as a substitute in de-icing compounds like calcium chloride and magnesium chloride.{{Cite web |title=Gallium acetate, 99.9% 2571-06-4 - Manufacturers & Suppliers in India with worldwide shipping. |url=https://www.ottokemi.com/gallium-compounds/gallium-acetate-pure.aspx |access-date=2022-05-05 |website=www.ottokemi.com}}