Gallocatechol
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 402432911
| ImageFile = (+)-Gallocatechin.svg
| ImageSize = 220px
| ImageFile2 = Gallocatechol 3D BS.png
| ImageSize2 = 220px
| IUPACName =
| OtherNames = (+)-Gallocatechin
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|changed|CAS}}
| CASNo = 970-73-0
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = HEJ6575V1X
| PubChem = 65084
| KEGG = C12127
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 58594
| SMILES = C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O
| InChI = 1/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15+/m0/s1
| InChIKey = XMOCLSLCDHWDHP-SWLSCSKDBQ
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XMOCLSLCDHWDHP-SWLSCSKDSA-N
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 68330
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 47386
| MeSHName = Gallocatechol
}}
|Section2={{Chembox Properties
| C=15 | H=14 | O=7
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Gallocatechol or gallocatechin (GC) is a flavan-3-ol, a type of chemical compound including catechin, with the gallate residue being in an isomeric trans position.
This compound possesses two epimers. The most common, (+)-gallocatechin (GC), CAS number 970-73-0, is found notably in green tea. The other enantiomer is called (−)-gallocatechin or ent-gallocatechin. It was first isolated from green tea by Michiyo Tsujimura in 1934.{{cite web|url=http://archives.cf.ocha.ac.jp/en/researcher/tsujimura_michiyo.html|publisher=Ochanomizu University|title=Michiyo Tsujimura (1888–1969)|access-date=10 November 2015|archive-date=21 November 2015|archive-url=https://web.archive.org/web/20151121161332/http://archives.cf.ocha.ac.jp/en/researcher/tsujimura_michiyo.html|url-status=dead}}
Epigallocatechin is another type of catechin, with the gallate residue being in an isomeric cis position. It can be found in St John's wort.{{cite journal | doi = 10.1016/j.chroma.2008.12.056| pmid = 19150073| pmc = 2777726| title = Separation of epigallocatechin and flavonoids from Hypericum perforatum L. By high-speed counter-current chromatography and preparative high-performance liquid chromatography| journal = Journal of Chromatography A| volume = 1216| issue = 19| pages = 4313–4318| year = 2009| last1 = Wei| first1 = Yun| last2 = Xie| first2 = Qianqian| last3 = Dong| first3 = Wanting| last4 = Ito| first4 = Yoichiro}}
See also
References
{{reflist}}
External links
- [https://www.sigmaaldrich.com/US/en/product/sial/e3768 Epigallocatechin on the Sigma-Aldrich website]
- [https://www.sigmaaldrich.com/US/en/product/sigma/g6657 Gallocatechin on the Sigma-Aldrich website]
{{Flavanols}}
{{Cannabinoidergics}}
{{GABAAR PAMs}}
{{GHBergics}}
Category:CB1 receptor agonists