Gemeprost
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 447612599
| IUPAC_name = methyl (2E,11α,13E,15R)-11,15-dihydroxy-16,16-dimethyl-9-oxoprosta-2,13-dien-1-oate
| image = Gemeprost.svg
| tradename = Cervagem
| Drugs.com = {{drugs.com|international|gemeprost}}
| pregnancy_AU = B3
| pregnancy_US =
| pregnancy_category =
| legal_AU = S4
| legal_CA =
| legal_UK = POM
| legal_US =
| legal_status =
| routes_of_administration = Pessary
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 64318-79-2
| ATC_prefix = G02
| ATC_suffix = AD03
| PubChem = 5282237
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB08964
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445416
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 45KZB1FOLS
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02073
| C=23 | H=38 | O=5
| smiles = O=C1C[C@@H](O)[C@H](/C=C/[C@@H](O)C(C)(C)CCCC)[C@H]1CCCC\C=C\C(=O)OC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H38O5/c1-5-6-15-23(2,3)21(26)14-13-18-17(19(24)16-20(18)25)11-9-7-8-10-12-22(27)28-4/h10,12-14,17-18,20-21,25-26H,5-9,11,15-16H2,1-4H3/b12-10+,14-13+/t17-,18-,20-,21-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KYBOHGVERHWSSV-VNIVIJDLSA-N
| synonyms = methyl (E)-7-[(1R,2S,3R)-3-hydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyl-oct-1-enyl]-5-oxo-cyclopentyl]hept-2-enoate
}}
Gemeprost (16, 16-dimethyl-trans-delta2 PGE1 methyl ester) is an analogue of prostaglandin E1.
Clinical use
It is used as a treatment for obstetric bleeding.{{fact|date=September 2021}}
It is used with mifepristone to terminate pregnancy up to 24 weeks gestation.{{cite journal | vauthors = Bartley J, Brown A, Elton R, Baird DT | title = Double-blind randomized trial of mifepristone in combination with vaginal gemeprost or misoprostol for induction of abortion up to 63 days gestation | journal = Human Reproduction | volume = 16 | issue = 10 | pages = 2098–102 | date = October 2001 | pmid = 11574498 | doi = 10.1093/humrep/16.10.2098 | doi-access = free }}
Side effects
Vaginal bleeding, cramps, nausea, vomiting,{{cite book | last=Aronson | first=J. K. | title=Meyler's Side Effects of Drugs: The International Encyclopedia of Adverse Drug Reactions and Interactions | publisher=Elsevier Science | year=2015 | isbn=978-0-4445-3716-4 | url=https://books.google.com/books?id=NOKoBAAAQBAJ | page=524}} loose stools or diarrhea, headache, muscle weakness; dizziness; flushing; chills; backache; dyspnoea; chest pain; palpitations and mild pyrexia. Rare: Uterine rupture, severe hypotension, coronary spasms with subsequent myocardial infarctions.{{fact|date=September 2021}}
References
{{Reflist}}
External links
- {{cite web | url = https://druginfo.nlm.nih.gov/drugportal/name/gemeprost | publisher = U.S. National Library of Medicine | work = Drug Information Portal | title = Gemeprost }}
{{Eicosanoids}}
{{Oxytocics}}
{{Prostanoidergics}}
{{Portal bar | Medicine}}