Geniposidic acid

{{Chembox

| ImageFile = Geniposidic acid.svg

| ImageSize = 200px

| ImageFile2 = Geniposidic acid 3D BS.png

| ImageSize2 = 200px

| IUPACName = (1S,4aS,7aS)-1-(β-D-Glucopyranosyloxy)-7-(hydroxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid

| SystematicName = (1S,4aS,7aS)-7-(Hydroxymethyl)-1-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 27741-01-1

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 443354

| ChemSpiderID = 391590

| ChEMBL = 460031

| SMILES = O=C(O)\C2=C\O[C@@H](O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)[C@@H]3C(=C/C[C@H]23)\CO

| InChI = InChI=1S/C16H22O10/c17-3-6-1-2-7-8(14(22)23)5-24-15(10(6)7)26-16-13(21)12(20)11(19)9(4-18)25-16/h1,5,7,9-13,15-21H,2-4H2,(H,22,23)/t7-,9-,10-,11-,12+,13-,15+,16+/m1/s1

}}

|Section2={{Chembox Properties

| C=16 | H=22 | O=10

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Geniposidic acid is a natural chemical compound, classified as an iridoid glucoside, found in a variety of plants including Eucommia ulmoides and Gardenia jasminoides.{{Cite web |url=http://www.genipin.cn/pro-3_e.htm |title=Geniposidic acid |access-date=2011-05-27 |archive-date=2021-04-13 |archive-url=https://web.archive.org/web/20210413201055/http://www.genipin.cn/pro-3_e.htm |url-status=dead }}